EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO5 |
| Net Charge | 0 |
| Average Mass | 163.129 |
| Monoisotopic Mass | 163.04807 |
| SMILES | N[C@H](C(=O)O)[C@H](O)CC(=O)O |
| InChI | InChI=1S/C5H9NO5/c6-4(5(10)11)2(7)1-3(8)9/h2,4,7H,1,6H2,(H,8,9)(H,10,11)/t2-,4+/m1/s1 |
| InChIKey | LKZIEAUIOCGXBY-FONMRSAGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-hydroxy-L-glutamic acid (CHEBI:48063) is a 3-hydroxy-L-glutamic acid (CHEBI:32809) |
| (R)-3-hydroxy-L-glutamic acid (CHEBI:48063) is conjugate acid of (3R)-3-hydroxy-L-glutamate(1−) (CHEBI:155841) |
| Incoming Relation(s) |
| (3R)-3-hydroxy-L-glutamate(1−) (CHEBI:155841) is conjugate base of (R)-3-hydroxy-L-glutamic acid (CHEBI:48063) |
| IUPAC Name |
|---|
| (3R)-3-hydroxy-L-glutamic acid |
| Synonym | Source |
|---|---|
| (2S,3R)-2-amino-3-hydroxypentanedioic acid (non-preferred name) | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1725027 | Beilstein |