EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:155841 - (3R)-3-hydroxy-L-glutamate(1−)
| Formula | C5H8NO5 |
| Net Charge | -1 |
| Average Mass | 162.121 |
| Monoisotopic Mass | 162.04080 |
| SMILES | [NH3+][C@H](C(=O)[O-])[C@H](O)CC(=O)[O-] |
| InChI | InChI=1S/C5H9NO5/c6-4(5(10)11)2(7)1-3(8)9/h2,4,7H,1,6H2,(H,8,9)(H,10,11)/p-1/t2-,4+/m1/s1 |
| InChIKey | LKZIEAUIOCGXBY-FONMRSAGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-hydroxy-L-glutamate(1−) (CHEBI:155841) has functional parent L-glutamate(1−) (CHEBI:29985) |
| (3R)-3-hydroxy-L-glutamate(1−) (CHEBI:155841) is a L-α-amino acid anion (CHEBI:59814) |
| (3R)-3-hydroxy-L-glutamate(1−) (CHEBI:155841) is conjugate base of (R)-3-hydroxy-L-glutamic acid (CHEBI:48063) |
| Incoming Relation(s) |
| (R)-3-hydroxy-L-glutamic acid (CHEBI:48063) is conjugate acid of (3R)-3-hydroxy-L-glutamate(1−) (CHEBI:155841) |
| UniProt Name | Source |
|---|---|
| (3R)-3-hydroxy-L-glutamate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| RXN-21520 | MetaCyc |
| Citations |
|---|