EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47893 - 4-O-β-D-glucosyl-4-coumarate
| Formula | C15H17O8 |
| Net Charge | -1 |
| Average Mass | 325.293 |
| Monoisotopic Mass | 325.09289 |
| SMILES | [H]C(=Cc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/p-1/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | LJFYQZQUAULRDF-TVKJYDDYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-β-D-glucosyl-4-coumarate (CHEBI:47893) has functional parent 4-coumarate (CHEBI:32373) |
| 4-O-β-D-glucosyl-4-coumarate (CHEBI:47893) is a monocarboxylic acid anion (CHEBI:35757) |
| 4-O-β-D-glucosyl-4-coumarate (CHEBI:47893) is conjugate base of 4-O-β-D-glucosyl-4-coumaric acid (CHEBI:17335) |
| Incoming Relation(s) |
| 4-O-β-D-glucosyl-trans-4-coumarate (CHEBI:79066) is a 4-O-β-D-glucosyl-4-coumarate (CHEBI:47893) |
| 4'-O-β-D-glucosyl-cis-p-coumarate (CHEBI:47892) is a 4-O-β-D-glucosyl-4-coumarate (CHEBI:47893) |
| 4-O-β-D-glucosyl-4-coumaric acid (CHEBI:17335) is conjugate acid of 4-O-β-D-glucosyl-4-coumarate (CHEBI:47893) |
| IUPAC Name |
|---|
| 3-[4-(β-D-glucopyranosyloxy)phenyl]prop-2-enoate |
| Synonyms | Source |
|---|---|
| 3-[4-(β-D-glucopyranosyloxy)phenyl]acrylate | ChEBI |
| 4-O-beta-D-Glucosyl-4-hydroxycinnamate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04415 | KEGG COMPOUND |