EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17O8 |
| Net Charge | -1 |
| Average Mass | 325.293 |
| Monoisotopic Mass | 325.09289 |
| SMILES | O=C([O-])/C=C\c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/p-1/b6-3-/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | LJFYQZQUAULRDF-LSSWKVNRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-β-D-glucosyl-cis-p-coumarate (CHEBI:47892) is a 4-O-β-D-glucosyl-4-coumarate (CHEBI:47893) |
| 4'-O-β-D-glucosyl-cis-p-coumarate (CHEBI:47892) is conjugate base of 4'-O-β-D-glucosyl-cis-p-coumaric acid (CHEBI:16099) |
| Incoming Relation(s) |
| 4'-O-β-D-glucosyl-cis-p-coumaric acid (CHEBI:16099) is conjugate acid of 4'-O-β-D-glucosyl-cis-p-coumarate (CHEBI:47892) |
| IUPAC Name |
|---|
| (2Z)-3-[4-(β-D-glucopyranosyloxy)phenyl]prop-2-enoate |
| Synonym | Source |
|---|---|
| (2Z)-3-[4-(β-D-glucopyranosyloxy)phenyl]acrylate | ChEBI |
| UniProt Name | Source |
|---|---|
| 4'-O-β-D-glucosyl-cis-4-coumarate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C06739 | KEGG COMPOUND |