EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N2O5 |
| Net Charge | 0 |
| Average Mass | 348.399 |
| Monoisotopic Mass | 348.16852 |
| SMILES | C[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H24N2O5/c1-12(16(21)20-11-5-8-15(20)18(24)25)19-14(17(22)23)10-9-13-6-3-2-4-7-13/h2-4,6-7,12,14-15,19H,5,8-11H2,1H3,(H,22,23)(H,24,25)/t12-,14-,15-/m0/s1 |
| InChIKey | LZFZMUMEGBBDTC-QEJZJMRPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enalaprilat (anhydrous) (CHEBI:4786) has role antihypertensive agent (CHEBI:35674) |
| enalaprilat (anhydrous) (CHEBI:4786) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| enalaprilat (anhydrous) (CHEBI:4786) is a dicarboxylic acid (CHEBI:35692) |
| enalaprilat (anhydrous) (CHEBI:4786) is a dipeptide (CHEBI:46761) |
| Incoming Relation(s) |
| enalapril (CHEBI:4784) has functional parent enalaprilat (anhydrous) (CHEBI:4786) |
| enalaprilat dihydrate (CHEBI:59877) has part enalaprilat (anhydrous) (CHEBI:4786) |
| IUPAC Name |
|---|
| N-[(1S)-1-carboxy-3-phenylpropyl]-L-alanyl-L-proline |
| Synonyms | Source |
|---|---|
| enalapril acid | ChemIDplus |
| enalaprilat | ChemIDplus |
| Enalaprilat | KEGG COMPOUND |
| enalaprilat anhydrous | ChemIDplus |
| enalaprilate | ChemIDplus |
| enalaprilatum | ChemIDplus |