EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4784 - enalapril
| Formula | C20H28N2O5 |
| Net Charge | 0 |
| Average Mass | 376.453 |
| Monoisotopic Mass | 376.19982 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C20H28N2O5/c1-3-27-20(26)16(12-11-15-8-5-4-6-9-15)21-14(2)18(23)22-13-7-10-17(22)19(24)25/h4-6,8-9,14,16-17,21H,3,7,10-13H2,1-2H3,(H,24,25)/t14-,16-,17-/m0/s1 |
| InChIKey | GBXSMTUPTTWBMN-XIRDDKMYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enalapril (CHEBI:4784) has functional parent enalaprilat (anhydrous) (CHEBI:4786) |
| enalapril (CHEBI:4784) has role antihypertensive agent (CHEBI:35674) |
| enalapril (CHEBI:4784) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| enalapril (CHEBI:4784) has role geroprotector (CHEBI:176497) |
| enalapril (CHEBI:4784) has role prodrug (CHEBI:50266) |
| enalapril (CHEBI:4784) is a dicarboxylic acid monoester (CHEBI:36244) |
| enalapril (CHEBI:4784) is a dipeptide (CHEBI:46761) |
| Incoming Relation(s) |
| enalapril maleate (CHEBI:4785) has part enalapril (CHEBI:4784) |
| IUPAC Name |
|---|
| N-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-L-alanyl-L-proline |
| INNs | Source |
|---|---|
| ánalapril | WHO MedNet |
| enalapril | ChemIDplus |
| enalaprila | ChemIDplus |
| enalaprilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(N-((S)-1-carboxy-3-phenylpropyl)-L-alanyl)-L-proline 1'-ethyl ester | ChemIDplus |
| Enalapril | KEGG COMPOUND |
| ENALAPRIL | ChEMBL |
| (S)-1-(N-(1-(ethoxycarbonyl)-3-phenylpropyl)-L-alanyl)-L-proline | ChemIDplus |
| (S)-1-{(S)-2-[1-((S)-Ethoxycarbonyl)-3-phenyl-propylamino]-propionyl}-pyrrolidine-2-carboxylic acid | ChEMBL |
| Citations |
|---|