EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4784 - enalapril
| Formula | C20H28N2O5 |
| Net Charge | 0 |
| Average Mass | 376.453 |
| Monoisotopic Mass | 376.19982 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C20H28N2O5/c1-3-27-20(26)16(12-11-15-8-5-4-6-9-15)21-14(2)18(23)22-13-7-10-17(22)19(24)25/h4-6,8-9,14,16-17,21H,3,7,10-13H2,1-2H3,(H,24,25)/t14-,16-,17-/m0/s1 |
| InChIKey | GBXSMTUPTTWBMN-XIRDDKMYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enalapril (CHEBI:4784) has functional parent enalaprilat (anhydrous) (CHEBI:4786) |
| enalapril (CHEBI:4784) has role antihypertensive agent (CHEBI:35674) |
| enalapril (CHEBI:4784) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| enalapril (CHEBI:4784) has role geroprotector (CHEBI:176497) |
| enalapril (CHEBI:4784) has role prodrug (CHEBI:50266) |
| enalapril (CHEBI:4784) is a dicarboxylic acid monoester (CHEBI:36244) |
| enalapril (CHEBI:4784) is a dipeptide (CHEBI:46761) |
| Incoming Relation(s) |
| enalapril maleate (CHEBI:4785) has part enalapril (CHEBI:4784) |
| IUPAC Name |
|---|
| N-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-L-alanyl-L-proline |
| INNs | Source |
|---|---|
| ánalapril | WHO MedNet |
| enalapril | ChemIDplus |
| enalaprila | ChemIDplus |
| enalaprilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(N-((S)-1-carboxy-3-phenylpropyl)-L-alanyl)-L-proline 1'-ethyl ester | ChemIDplus |
| Enalapril | KEGG COMPOUND |
| ENALAPRIL | ChEMBL |
| (S)-1-(N-(1-(ethoxycarbonyl)-3-phenylpropyl)-L-alanyl)-L-proline | ChemIDplus |
| (S)-1-{(S)-2-[1-((S)-Ethoxycarbonyl)-3-phenyl-propylamino]-propionyl}-pyrrolidine-2-carboxylic acid | ChEMBL |
| Citations |
|---|