EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47832 - (2S,5R)-methionine sulfoximine
| Formula | C5H12N2O3S |
| Net Charge | 0 |
| Average Mass | 180.229 |
| Monoisotopic Mass | 180.05686 |
| SMILES | C[S@@](=N)(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O3S/c1-11(7,10)3-2-4(6)5(8)9/h4,7H,2-3,6H2,1H3,(H,8,9)/t4-,11+/m0/s1 |
| InChIKey | SXTAYKAGBXMACB-AQPAIEDISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor An EC 6.3.* (C‒N bond-forming ligase) inhibitor that interferes with the action of glutamate—ammonia ligase (EC 6.3.1.2). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,5R)-methionine sulfoximine (CHEBI:47832) is a L-methionine sulfoximine (CHEBI:28490) |
| IUPAC Name |
|---|
| (2S,5R)-2-amino-4-(S-methylsulfonimidoyl)butanoic acid |
| Synonym | Source |
|---|---|
| (R-(R*,S*))-S-(3-amino-3-carboxypropyl)-S-methylsulphoximide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4132527 | Beilstein |
| CAS:21752-31-8 | ChemIDplus |