EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O3S |
| Net Charge | 0 |
| Average Mass | 180.229 |
| Monoisotopic Mass | 180.05686 |
| SMILES | CS(=N)(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O3S/c1-11(7,10)3-2-4(6)5(8)9/h4,7H,2-3,6H2,1H3,(H,8,9)/t4-,11?/m0/s1 |
| InChIKey | SXTAYKAGBXMACB-DPVSGNNYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor An EC 6.3.* (C‒N bond-forming ligase) inhibitor that interferes with the action of glutamate—ammonia ligase (EC 6.3.1.2). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-methionine sulfoximine (CHEBI:28490) has role EC 6.3.1.2 (glutamate—ammonia ligase) inhibitor (CHEBI:24319) |
| L-methionine sulfoximine (CHEBI:28490) has role geroprotector (CHEBI:176497) |
| L-methionine sulfoximine (CHEBI:28490) is a L-methionine derivative (CHEBI:84121) |
| L-methionine sulfoximine (CHEBI:28490) is a methionine sulfoximine (CHEBI:47833) |
| L-methionine sulfoximine (CHEBI:28490) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-methionine sulfoximine (CHEBI:28490) is tautomer of L-methionine sulfoximine zwitterion (CHEBI:87826) |
| Incoming Relation(s) |
| (2S,5R)-methionine sulfoximine (CHEBI:47832) is a L-methionine sulfoximine (CHEBI:28490) |
| (2S,5S)-methionine sulfoximine (CHEBI:28227) is a L-methionine sulfoximine (CHEBI:28490) |
| L-methionine sulfoximine zwitterion (CHEBI:87826) is tautomer of L-methionine sulfoximine (CHEBI:28490) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-(S-methylsulfonimidoyl)butanoic acid |
| Synonym | Source |
|---|---|
| L-Methionine sulfoximine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03510 | KEGG COMPOUND |
| C03829 | KEGG COMPOUND |
| CPD-9035 | MetaCyc |
| HMDB0029430 | HMDB |
| MSL | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6175446 | Reaxys |
| CAS:15985-39-4 | ChemIDplus |
| CAS:15985-39-4 | KEGG COMPOUND |
| Citations |
|---|