EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47693 - keto-D-tagatose
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O=C(CO)[C@@H](O)[C@@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[hO112h]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6-/m1/s1 |
| InChIKey | BJHIKXHVCXFQLS-PQLUHFTBSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-D-tagatose (CHEBI:47693) is a D-tagatose (CHEBI:16443) |
| keto-D-tagatose (CHEBI:47693) is enantiomer of keto-L-tagatose (CHEBI:134275) |
| Incoming Relation(s) |
| keto-D-tagatose 1,6-bisphosphate (CHEBI:49093) has functional parent keto-D-tagatose (CHEBI:47693) |
| keto-D-tagatose 6-phosphate (CHEBI:47947) has functional parent keto-D-tagatose (CHEBI:47693) |
| keto-L-tagatose (CHEBI:134275) is enantiomer of keto-D-tagatose (CHEBI:47693) |
| IUPAC Names |
|---|
| keto-D-tagatose |
| (3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| Synonym | Source |
|---|---|
| D-tagatose | PDBeChem |
| UniProt Name | Source |
|---|---|
| keto-D-tagatose | UniProt |