EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O=C(CO)[C@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[hO221h]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6-/m0/s1 |
| InChIKey | BJHIKXHVCXFQLS-LFRDXLMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Klebsiella aerogenes (ncbitaxon:548) | - | PubMed (19111643) | Also known as Enterobacter aerogenes and Aerobacter aerogenes Strain: 230S |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-L-tagatose (CHEBI:134275) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| keto-L-tagatose (CHEBI:134275) is a L-tagatose (CHEBI:37462) |
| keto-L-tagatose (CHEBI:134275) is enantiomer of keto-D-tagatose (CHEBI:47693) |
| Incoming Relation(s) |
| keto-D-tagatose (CHEBI:47693) is enantiomer of keto-L-tagatose (CHEBI:134275) |
| IUPAC Name |
|---|
| L-tagatose |
| Synonyms | Source |
|---|---|
| (3R,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one | IUPAC |
| L-lyxo-2-hexulose | ChEBI |
| UniProt Name | Source |
|---|---|
| keto-L-tagatose | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724558 | Reaxys |
| CAS:17598-82-2 | ChemIDplus |
| Citations |
|---|