EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19Cl2F3N3O8P |
| Net Charge | 0 |
| Average Mass | 588.259 |
| Monoisotopic Mass | 587.02389 |
| SMILES | O=C(N[C@H](CO)[C@H](OP(=O)(O)Cc1ccc(NC(=O)C(F)(F)F)cc1)c1ccc([N+](=O)[O-])cc1)C(Cl)Cl |
| InChI | InChI=1S/C20H19Cl2F3N3O8P/c21-17(22)18(30)27-15(9-29)16(12-3-7-14(8-4-12)28(32)33)36-37(34,35)10-11-1-5-13(6-2-11)26-19(31)20(23,24)25/h1-8,15-17,29H,9-10H2,(H,26,31)(H,27,30)(H,34,35)/t15-,16-/m1/s1 |
| InChIKey | GXXWSSFOFDWOBZ-HZPDHXFCSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(4-trifluoroacetamidobenzylphosphonyl)chloramphenicol (CHEBI:47691) has functional parent chloramphenicol (CHEBI:17698) |
| O-(4-trifluoroacetamidobenzylphosphonyl)chloramphenicol (CHEBI:47691) has role hapten (CHEBI:59174) |
| O-(4-trifluoroacetamidobenzylphosphonyl)chloramphenicol (CHEBI:47691) is a C-nitro compound (CHEBI:35716) |
| O-(4-trifluoroacetamidobenzylphosphonyl)chloramphenicol (CHEBI:47691) is a organochlorine compound (CHEBI:36683) |
| O-(4-trifluoroacetamidobenzylphosphonyl)chloramphenicol (CHEBI:47691) is a trifluoroacetamide (CHEBI:145723) |
| IUPAC Name |
|---|
| (1R,2R)-2-[(dichloroacetyl)amino]-3-hydroxy-1-(4-nitrophenyl)propyl hydrogen {4-[(trifluoroacetyl)amino]benzyl}phosphonate |
| Manual Xrefs | Databases |
|---|---|
| 1CT8 | PDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7326264 | Reaxys |
| Citations |
|---|