EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12Cl2N2O5 |
| Net Charge | 0 |
| Average Mass | 323.132 |
| Monoisotopic Mass | 322.01233 |
| SMILES | O=C(N[C@H](CO)[C@H](O)c1ccc([N+](=O)[O-])cc1)C(Cl)Cl |
| InChI | InChI=1S/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/m1/s1 |
| InChIKey | WIIZWVCIJKGZOK-RKDXNWHRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) | Binds L16 protein of the 50S ribosomal subunit and inhibits amino acid transfer to growing peptide chains |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antibacterial drug A drug used to treat or prevent bacterial infections. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloramphenicol (CHEBI:17698) has role Escherichia coli metabolite (CHEBI:76971) |
| chloramphenicol (CHEBI:17698) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| chloramphenicol (CHEBI:17698) has role antibacterial agent (CHEBI:33282) |
| chloramphenicol (CHEBI:17698) has role antibacterial drug (CHEBI:36047) |
| chloramphenicol (CHEBI:17698) has role antimicrobial agent (CHEBI:33281) |
| chloramphenicol (CHEBI:17698) has role geroprotector (CHEBI:176497) |
| chloramphenicol (CHEBI:17698) has role ophthalmology drug (CHEBI:66981) |
| chloramphenicol (CHEBI:17698) has role protein synthesis inhibitor (CHEBI:48001) |
| chloramphenicol (CHEBI:17698) is a C-nitro compound (CHEBI:35716) |
| chloramphenicol (CHEBI:17698) is a carboxamide (CHEBI:37622) |
| chloramphenicol (CHEBI:17698) is a diol (CHEBI:23824) |
| chloramphenicol (CHEBI:17698) is a organochlorine compound (CHEBI:36683) |
| Incoming Relation(s) |
| O-(4-trifluoroacetamidobenzylphosphonyl)chloramphenicol (CHEBI:47691) has functional parent chloramphenicol (CHEBI:17698) |
| O3-(2-L-lysino-2-oxoethyl)-O1-[4-(trifluoroacetamido)benzylcarbonyl]chloramphenicol (CHEBI:63766) has functional parent chloramphenicol (CHEBI:17698) |
| chloramphenicol 3-acetate (CHEBI:16730) has functional parent chloramphenicol (CHEBI:17698) |
| chloramphenicol palmitate (CHEBI:3605) has functional parent chloramphenicol (CHEBI:17698) |
| IUPAC Name |
|---|
| 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acetamide |
| INNs | Source |
|---|---|
| chloramphenicol | WHO MedNet |
| chloramphénicol | WHO MedNet |
| chloramphenicolum | WHO MedNet |
| cloramfenicol | WHO MedNet |
| cloranfenicol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 9-hydroxy-9-phenylxanthene | ChEMBL |
| 9-phenyl-9h-xanthen-9-ol | ChEMBL |
| (−)-chloramphenicol | ChEBI |
| Chloramphenicol | KEGG COMPOUND |
| CHLORAMPHENICOL | PDBeChem |
| chlornitromycin | ChEBI |
| Brand Names | Source |
|---|---|
| Amphicol | KEGG DRUG |
| Brochlor | ChEMBL |
| Brolene antibiotic | ChEMBL |
| Chloramex | ChemIDplus |
| Chloramphenicol component of chloromycetin hydrocortisone | ChEMBL |
| Chloramphenicol component of chloromyxin | ChEMBL |
| UniProt Name | Source |
|---|---|
| chloramphenicol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1835 | VSDB |
| 5744 | ChemSpider |
| 589 | DrugCentral |
| C00918 | KEGG COMPOUND |
| chloramphenicol | Alan Wood's Pesticides |
| Chloramphenicol | Wikipedia |
| CHLORAMPHENICOL | MetaCyc |
| CLM | PDBeChem |
| D00104 | KEGG DRUG |
| DB00446 | DrugBank |
| GB795131 | Patent |
| GB796901 | Patent |
| HMDB0014589 | HMDB |
| LSM-5256 | LINCS |
| US2483871 | Patent |
| US2483884 | Patent |
| US2483892 | Patent |
| US2839577 | Patent |
| Citations |
|---|