EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H45ClN6O5S2 |
| Net Charge | 0 |
| Average Mass | 813.446 |
| Monoisotopic Mass | 812.25814 |
| SMILES | CN(C)CC[C@H](CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(Cl)cc4)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C42H45ClN6O5S2/c1-46(2)23-22-35(30-55-37-9-4-3-5-10-37)44-40-21-20-38(28-41(40)49(51)52)56(53,54)45-42(50)32-14-18-36(19-15-32)48-26-24-47(25-27-48)29-33-8-6-7-11-39(33)31-12-16-34(43)17-13-31/h3-21,28,35,44H,22-27,29-30H2,1-2H3,(H,45,50)/t35-/m1/s1 |
| InChIKey | HPLNQCPCUACXLM-PGUFJCEWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | B-cell lymphoma 2 inhibitor Any inhibitor of B-cell lymphoma 2 protein. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-allergic agent A drug used to treat allergic reactions. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ABT-737 (CHEBI:47575) has role anti-allergic agent (CHEBI:50857) |
| ABT-737 (CHEBI:47575) has role anti-inflammatory agent (CHEBI:67079) |
| ABT-737 (CHEBI:47575) has role antineoplastic agent (CHEBI:35610) |
| ABT-737 (CHEBI:47575) has role apoptosis inducer (CHEBI:68495) |
| ABT-737 (CHEBI:47575) has role B-cell lymphoma 2 inhibitor (CHEBI:133022) |
| ABT-737 (CHEBI:47575) is a C-nitro compound (CHEBI:35716) |
| ABT-737 (CHEBI:47575) is a N-arylpiperazine (CHEBI:46848) |
| ABT-737 (CHEBI:47575) is a N-sulfonylcarboxamide (CHEBI:90852) |
| ABT-737 (CHEBI:47575) is a aromatic amine (CHEBI:33860) |
| ABT-737 (CHEBI:47575) is a aryl sulfide (CHEBI:35683) |
| ABT-737 (CHEBI:47575) is a biphenyls (CHEBI:22888) |
| ABT-737 (CHEBI:47575) is a monochlorobenzenes (CHEBI:83403) |
| ABT-737 (CHEBI:47575) is a secondary amino compound (CHEBI:50995) |
| ABT-737 (CHEBI:47575) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-{4-[(4'-chloro[biphenyl]-2-yl)methyl]piperazin-1-yl}-N-[(4-{[(2R)-4-(dimethylamino)-1-(phenylsulfanyl)butan-2-yl]amino}-3-nitrophenyl)sulfonyl]benzamide |
| Synonyms | Source |
|---|---|
| 4-{4-[(4'-chloro[1,1'-biphenyl]-2-yl)methyl]piperazin-1-yl}-N-(4-{[(2R)-4-(dimethylamino)-1-(phenylsulfanyl)butan-2-yl]amino}-3-nitrobenzene-1-sulfonyl)benzamide | IUPAC |
| ABT 737 | ChemIDplus |
| ABT737 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:852808-04-9 | ChemIDplus |
| Citations |
|---|