EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16ClN3O4 |
| Net Charge | 0 |
| Average Mass | 349.774 |
| Monoisotopic Mass | 349.08293 |
| SMILES | N[C@@H](C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(Cl)CC[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C16H16ClN3O4/c17-9-6-7-10-12(15(22)20(10)13(9)16(23)24)19-14(21)11(18)8-4-2-1-3-5-8/h1-5,10-12H,6-7,18H2,(H,19,21)(H,23,24)/t10-,11-,12+/m1/s1 |
| InChIKey | JAPHQRWPEGVNBT-UTUOFQBUSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loracarbef (CHEBI:47544) has role antibacterial drug (CHEBI:36047) |
| loracarbef (CHEBI:47544) has role antimicrobial agent (CHEBI:33281) |
| loracarbef (CHEBI:47544) is a carbacephem (CHEBI:55504) |
| loracarbef (CHEBI:47544) is conjugate acid of loracarbef anion (CHEBI:281056) |
| loracarbef (CHEBI:47544) is tautomer of loracarbef zwitterion (CHEBI:214480) |
| Incoming Relation(s) |
| loracarbef anion (CHEBI:281056) is conjugate base of loracarbef (CHEBI:47544) |
| loracarbef zwitterion (CHEBI:214480) is tautomer of loracarbef (CHEBI:47544) |
| IUPAC Names |
|---|
| (6R,7S)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7β-[(2R)-2-amino-2-phenylacetyl]nitrilo-3-chloro-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| loracarbef | ChemIDplus |
| loracarbefum | ChemIDplus |
| Synonym | Source |
|---|---|
| LORACABEF | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3631282 | Reaxys |
| CAS:76470-66-1 | KEGG DRUG |
| CAS:76470-66-1 | ChemIDplus |
| Citations |
|---|