EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16ClN3O4 |
| Net Charge | 0 |
| Average Mass | 349.774 |
| Monoisotopic Mass | 349.08293 |
| SMILES | [NH3+][C@@H](C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(Cl)CC[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C16H16ClN3O4/c17-9-6-7-10-12(15(22)20(10)13(9)16(23)24)19-14(21)11(18)8-4-2-1-3-5-8/h1-5,10-12H,6-7,18H2,(H,19,21)(H,23,24)/t10-,11-,12+/m1/s1 |
| InChIKey | JAPHQRWPEGVNBT-UTUOFQBUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loracarbef zwitterion (CHEBI:214480) is a carbacephem (CHEBI:55504) |
| loracarbef zwitterion (CHEBI:214480) is a zwitterion (CHEBI:27369) |
| loracarbef zwitterion (CHEBI:214480) is tautomer of loracarbef (CHEBI:47544) |
| Incoming Relation(s) |
| loracarbef (CHEBI:47544) is tautomer of loracarbef zwitterion (CHEBI:214480) |
| IUPAC Names |
|---|
| (6R,7S)-7-{[(2R)-2-ammonio-2-phenylacetyl]amino}-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| 7β-[(2R)-2-ammonio-2-phenylacetyl]nitrilo-3-chloro-3,4-didehydrocepham-4-carboxylate |
| Synonym | Source |
|---|---|
| loracarbef | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Loracarbef | Wikipedia |