EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N3O7S |
| Net Charge | 0 |
| Average Mass | 475.523 |
| Monoisotopic Mass | 475.14132 |
| SMILES | CNc1nc2c(Cc3cccnc3)c(C)c(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)c(C)c2s1 |
| InChI | InChI=1S/C22H25N3O7S/c1-9-12(7-11-5-4-6-24-8-11)13-19(33-22(23-3)25-13)10(2)17(9)31-21-16(28)14(26)15(27)18(32-21)20(29)30/h4-6,8,14-16,18,21,26-28H,7H2,1-3H3,(H,23,25)(H,29,30)/t14-,15-,16+,18-,21+/m0/s1 |
| InChIKey | RJBKVKVYNJTHJS-DQSYDGHTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| E3040 glucuronide (CHEBI:4733) has functional parent E3040 (CHEBI:4732) |
| E3040 glucuronide (CHEBI:4733) has role xenobiotic metabolite (CHEBI:76206) |
| E3040 glucuronide (CHEBI:4733) is a benzothiazoles (CHEBI:37947) |
| E3040 glucuronide (CHEBI:4733) is a pyridines (CHEBI:26421) |
| E3040 glucuronide (CHEBI:4733) is a secondary amino compound (CHEBI:50995) |
| E3040 glucuronide (CHEBI:4733) is a β-D-glucosiduronic acid (CHEBI:15341) |
| E3040 glucuronide (CHEBI:4733) is conjugate acid of 5,7-dimethyl-2-methylamino-4-(3-pyridylmethyl)-1,3-benzothiazol-6-yl β-D-glucuronide(1−) (CHEBI:144584) |
| Incoming Relation(s) |
| 5,7-dimethyl-2-methylamino-4-(3-pyridylmethyl)-1,3-benzothiazol-6-yl β-D-glucuronide(1−) (CHEBI:144584) is conjugate base of E3040 glucuronide (CHEBI:4733) |
| IUPAC Name |
|---|
| 5,7-dimethyl-2-(methylamino)-4-(pyridin-3-ylmethyl)-1,3-benzothiazol-6-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 2-(methylamino)-5,7-dimethyl-4-(3-pyridinylmethyl)benzothiazole-6-yl β-D-glucopyranosiduronic acid | ChEBI |
| E-3040 glucuronide | ChEBI |
| E3040 glucuronide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11595 | KEGG COMPOUND |
| Citations |
|---|