EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3OS |
| Net Charge | 0 |
| Average Mass | 299.399 |
| Monoisotopic Mass | 299.10923 |
| SMILES | CNc1nc2c(Cc3cccnc3)c(C)c(O)c(C)c2s1 |
| InChI | InChI=1S/C16H17N3OS/c1-9-12(7-11-5-4-6-18-8-11)13-15(10(2)14(9)20)21-16(17-3)19-13/h4-6,8,20H,7H2,1-3H3,(H,17,19) |
| InChIKey | IONAQTGMWFXHIX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. uricosuric drug A gout suppressant that acts directly on the renal tubule to increase the excretion of uric acid, thus reducing its concentrations in plasma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| E3040 (CHEBI:4732) has role anti-inflammatory drug (CHEBI:35472) |
| E3040 (CHEBI:4732) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| E3040 (CHEBI:4732) has role uricosuric drug (CHEBI:35841) |
| E3040 (CHEBI:4732) is a benzothiazoles (CHEBI:37947) |
| E3040 (CHEBI:4732) is a organic hydroxy compound (CHEBI:33822) |
| E3040 (CHEBI:4732) is a pyridines (CHEBI:26421) |
| E3040 (CHEBI:4732) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| 5,7-dimethyl-2-methylamino-4-(3-pyridylmethyl)-1,3-benzothiazol-6-yl hydrogen sulfate (CHEBI:4734) has functional parent E3040 (CHEBI:4732) |
| E3040 glucuronide (CHEBI:4733) has functional parent E3040 (CHEBI:4732) |
| IUPAC Name |
|---|
| 5,7-dimethyl-2-(methylamino)-4-(pyridin-3-ylmethyl)-1,3-benzothiazol-6-ol |
| Synonyms | Source |
|---|---|
| 6-hydroxy-5,7-dimethyl-2-methylamino-4-(3-pyridylmethyl) benzothiazole | ChEBI |
| E-3040 | ChEBI |
| E3040 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11593 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:145096-30-6 | ChemIDplus |
| Citations |
|---|