EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O2 |
| Net Charge | 0 |
| Average Mass | 228.291 |
| Monoisotopic Mass | 228.11503 |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16-17H,1-2H3 |
| InChIKey | IISBACLAFKSPIT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisphenol A (CHEBI:33216) has role endocrine disruptor (CHEBI:138015) |
| bisphenol A (CHEBI:33216) has role environmental contaminant (CHEBI:78298) |
| bisphenol A (CHEBI:33216) has role xenobiotic (CHEBI:35703) |
| bisphenol A (CHEBI:33216) has role xenoestrogen (CHEBI:76988) |
| bisphenol A (CHEBI:33216) is a bisphenol (CHEBI:22901) |
| Incoming Relation(s) |
| 3,3',5,5'-tetrabromobisphenol A (CHEBI:33217) has functional parent bisphenol A (CHEBI:33216) |
| 4-[2-(4-methoxyphenyl)propan-2-yl]phenol (CHEBI:131346) has functional parent bisphenol A (CHEBI:33216) |
| 5-hydroxybisphenol A (CHEBI:31133) has functional parent bisphenol A (CHEBI:33216) |
| bisphenol A (3-chloro-2-hydroxypropyl) (2,3-dihydroxypropyl) ether (CHEBI:59642) has functional parent bisphenol A (CHEBI:33216) |
| bisphenol A dimethacrylate (CHEBI:34579) has functional parent bisphenol A (CHEBI:33216) |
| bisphenol A sulfate (CHEBI:167305) has functional parent bisphenol A (CHEBI:33216) |
| bisphenol AF (CHEBI:72754) has functional parent bisphenol A (CHEBI:33216) |
| IUPAC Name |
|---|
| 4,4'-(propane-2,2-diyl)diphenol |
| Synonyms | Source |
|---|---|
| 2, 2-Bis(4-hydroxyphenyl)propane | HMDB |
| 2,2-Bis(4-Hydroxyphenyl)propane | KEGG COMPOUND |
| 2,2-Bis(4'-hydroxyphenyl)propane | HMDB |
| 2,2-Bis(p-hydroxyphenyl)propane | ChemIDplus |
| 2,2-Di(4-hydroxyphenyl)propane | ChemIDplus |
| 2,2-Di(4-phenylol)propane | ChemIDplus |
| UniProt Name | Source |
|---|---|
| bisphenol A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2OH | PDBeChem |
| Bisphenol_A | Wikipedia |
| c0764 | UM-BBD |
| C13624 | KEGG COMPOUND |
| DB06973 | DrugBank |
| HMDB0032133 | HMDB |
| LSM-37080 | LINCS |
| Citations |
|---|