EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12Br4O2 |
| Net Charge | 0 |
| Average Mass | 543.875 |
| Monoisotopic Mass | 539.75708 |
| SMILES | CC(C)(c1cc(Br)c(O)c(Br)c1)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H12Br4O2/c1-15(2,7-3-9(16)13(20)10(17)4-7)8-5-11(18)14(21)12(19)6-8/h3-6,20-21H,1-2H3 |
| InChIKey | VEORPZCZECFIRK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Application: | flame retardant Any compound that is added to manufactured materials to inhibit, suppress, or delay the production of flames and so prevent the spread of fire. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3',5,5'-tetrabromobisphenol A (CHEBI:33217) has functional parent bisphenol A (CHEBI:33216) |
| 3,3',5,5'-tetrabromobisphenol A (CHEBI:33217) is a brominated flame retardant (CHEBI:172368) |
| 3,3',5,5'-tetrabromobisphenol A (CHEBI:33217) is a bromobisphenol (CHEBI:22931) |
| IUPAC Name |
|---|
| 4,4'-(propane-2,2-diyl)bis(2,6-dibromophenol) |
| Synonyms | Source |
|---|---|
| 2,2',6,6'-Tetrabromobisphenol A | ChemIDplus |
| 2,2-Bis(3,5-dibromo-4-hydroxyphenyl)propane | ChemIDplus |
| 3,3',5,5'-Tetrabromobisphenol A | KEGG COMPOUND |
| 4,4'-(1-Methylethylidene)bis(2,6-dibromophenol) | ChemIDplus |
| 4,4'-(2,2-propanediyl) bis[2,6-dibromo]phenol | NIST Chemistry WebBook |
| 4,4'-Isopropylidenebis(2,6-dibromophenol) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| c0763 | UM-BBD |
| C13620 | KEGG COMPOUND |
| Tetrabromobisphenol_A | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1889048 | Reaxys |
| CAS:79-94-7 | ChemIDplus |
| CAS:79-94-7 | KEGG COMPOUND |
| Citations |
|---|