EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O4 |
| Net Charge | 0 |
| Average Mass | 234.251 |
| Monoisotopic Mass | 234.08921 |
| SMILES | C=C[C@H](OC(C)=O)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C13H14O4/c1-4-13(17-10(3)15)11-5-7-12(8-6-11)16-9(2)14/h4-8,13H,1H2,2-3H3/t13-/m0/s1 |
| InChIKey | JAMQIUWGGBSIKZ-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1'-acetoxychavicol acetate (CHEBI:469) has functional parent chavicol (CHEBI:50158) |
| 1'-acetoxychavicol acetate (CHEBI:469) has role antineoplastic agent (CHEBI:35610) |
| 1'-acetoxychavicol acetate (CHEBI:469) has role NF-κB inhibitor (CHEBI:73240) |
| 1'-acetoxychavicol acetate (CHEBI:469) has role plant metabolite (CHEBI:76924) |
| 1'-acetoxychavicol acetate (CHEBI:469) is a acetate ester (CHEBI:47622) |
| 1'-acetoxychavicol acetate (CHEBI:469) is a phenylpropanoid (CHEBI:26004) |
| IUPAC Name |
|---|
| (1S)-1-[4-(acetyloxy)phenyl]prop-2-en-1-yl acetate |
| Synonyms | Source |
|---|---|
| 1'-Acetoxychavicol acetate | KEGG COMPOUND |
| (alphaS)-4-(Acetyloxy)-alpha-ethenylbenzenemethanol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2376729 | Reaxys |
| CAS:52946-22-2 | ChemIDplus |
| CAS:52946-22-2 | KEGG COMPOUND |
| Citations |
|---|