EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4NO4 |
| Net Charge | -1 |
| Average Mass | 166.112 |
| Monoisotopic Mass | 166.01458 |
| SMILES | O=C([O-])c1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-3H,(H,9,10)(H,11,12)/p-1 |
| InChIKey | MPFLRYZEEAQMLQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dinicotinate(1−) (CHEBI:46878) is a carboxypyridinecarboxylate (CHEBI:46827) |
| dinicotinate(1−) (CHEBI:46878) is conjugate acid of dinicotinate(2−) (CHEBI:46877) |
| dinicotinate(1−) (CHEBI:46878) is conjugate base of dinicotinic acid (CHEBI:46875) |
| Incoming Relation(s) |
| dinicotinic acid (CHEBI:46875) is conjugate acid of dinicotinate(1−) (CHEBI:46878) |
| dinicotinate(2−) (CHEBI:46877) is conjugate base of dinicotinate(1−) (CHEBI:46878) |
| IUPAC Name |
|---|
| 5-carboxypyridine-3-carboxylate |
| Synonyms | Source |
|---|---|
| 5-carboxynicotinate | IUPAC |
| hydrogen dinicotinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1342587 | Gmelin |