EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3NO4 |
| Net Charge | -2 |
| Average Mass | 165.104 |
| Monoisotopic Mass | 165.00730 |
| SMILES | O=C([O-])c1cncc(C(=O)[O-])c1 |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-3H,(H,9,10)(H,11,12)/p-2 |
| InChIKey | MPFLRYZEEAQMLQ-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dinicotinate(2−) (CHEBI:46877) is a pyridinedicarboxylate (CHEBI:36173) |
| dinicotinate(2−) (CHEBI:46877) is conjugate base of dinicotinate(1−) (CHEBI:46878) |
| Incoming Relation(s) |
| dinicotinate(1−) (CHEBI:46878) is conjugate acid of dinicotinate(2−) (CHEBI:46877) |
| IUPAC Name |
|---|
| pyridine-3,5-dicarboxylate |
| Synonym | Source |
|---|---|
| dinicotinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1484440 | Gmelin |