EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N2O2 |
| Net Charge | 0 |
| Average Mass | 114.104 |
| Monoisotopic Mass | 114.04293 |
| SMILES | N[C@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C4H6N2O2/c5-2-1-3(7)6-4(2)8/h2H,1,5H2,(H,6,7,8)/t2-/m0/s1 |
| InChIKey | YDNMHDRXNOHCJH-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-3-aminosuccinimide (CHEBI:46749) is a 3-aminosuccinimide (CHEBI:195552) |
| IUPAC Name |
|---|
| (3S)-3-aminopyrrolidine-2,5-dione |
| Synonyms | Source |
|---|---|
| L-aspartimide | ChEBI |
| (S)-3-amino-2,5-pyrrolidinedione | ChEBI |
| (S)-3-aminopyrrolidine-2,5-dione | ChEBI |
| 3S-amino-2,5-pyrrolidinedione | ChEBI |
| (3S)-3-amino-2,5-pyrrolidinedione | ChEBI |
| (S)-aspartimide | ChEBI |
| Citations |
|---|