EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7Cl2NO2S |
| Net Charge | 0 |
| Average Mass | 216.089 |
| Monoisotopic Mass | 214.95745 |
| SMILES | N[C@@H](CS/C(Cl)=C/Cl)C(=O)O |
| InChI | InChI=1S/C5H7Cl2NO2S/c6-1-4(7)11-2-3(8)5(9)10/h1,3H,2,8H2,(H,9,10)/b4-1+/t3-/m0/s1 |
| InChIKey | PJIHCWJOTSJIPQ-AGFFZDDWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(cis-1,2-dichlorovinyl)-L-cysteine (CHEBI:46654) is a S-(1,2-dichlorovinyl)-L-cysteine (CHEBI:46650) |
| IUPAC Names |
|---|
| (2R)-2-amino-3-{[(Z)-1,2-dichloroethenyl]sulfanyl}propanoic acid |
| S-[(Z)-1,2-dichloroethenyl]-L-cysteine |
| Synonym | Source |
|---|---|
| S-[(Z)-1,2-dichlorovinyl]-L-cysteine | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8544600 | Beilstein |