EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7Cl2NO2S |
| Net Charge | 0 |
| Average Mass | 216.089 |
| Monoisotopic Mass | 214.95745 |
| SMILES | [H]C(Cl)=C(Cl)SC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H7Cl2NO2S/c6-1-4(7)11-2-3(8)5(9)10/h1,3H,2,8H2,(H,9,10)/t3-/m0/s1 |
| InChIKey | PJIHCWJOTSJIPQ-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(1,2-dichlorovinyl)-L-cysteine (CHEBI:46650) is a L-cysteine thioether (CHEBI:27532) |
| S-(1,2-dichlorovinyl)-L-cysteine (CHEBI:46650) is a monocarboxylic acid (CHEBI:25384) |
| S-(1,2-dichlorovinyl)-L-cysteine (CHEBI:46650) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| S-(1,2-dichlorovinyl)-L-cysteine (CHEBI:46650) is a organochlorine compound (CHEBI:36683) |
| Incoming Relation(s) |
| S-(cis-1,2-dichlorovinyl)-L-cysteine (CHEBI:46654) is a S-(1,2-dichlorovinyl)-L-cysteine (CHEBI:46650) |
| S-(trans-1,2-dichlorovinyl)-L-cysteine (CHEBI:46651) is a S-(1,2-dichlorovinyl)-L-cysteine (CHEBI:46650) |
| IUPAC Names |
|---|
| S-(1,2-dichloroethenyl)-L-cysteine |
| (2R)-2-amino-3-[(1,2-dichloroethenyl)sulfanyl]propanoic acid |
| Synonyms | Source |
|---|---|
| S-(1,2-dichlorovinyl)-L-cysteine | ChemIDplus |
| 3-((1,2-dichlorovinyl)thio)-L-alanine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6582125 | Beilstein |
| CAS:627-72-5 | ChemIDplus |