EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10O2S2 |
| Net Charge | 0 |
| Average Mass | 154.256 |
| Monoisotopic Mass | 154.01222 |
| SMILES | OC(CS)C(O)CS |
| InChI | InChI=1S/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2 |
| InChIKey | VHJLVAABSRFDPM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4-dithiothreitol (CHEBI:18320) has role chelator (CHEBI:38161) |
| 1,4-dithiothreitol (CHEBI:18320) has role human metabolite (CHEBI:77746) |
| 1,4-dithiothreitol (CHEBI:18320) has role reducing agent (CHEBI:63247) |
| 1,4-dithiothreitol (CHEBI:18320) is a 1,4-dimercaptobutane-2,3-diol (CHEBI:25189) |
| 1,4-dithiothreitol (CHEBI:18320) is a dithiol (CHEBI:23853) |
| Incoming Relation(s) |
| D-1,4-dithiothreitol (CHEBI:42170) is a 1,4-dithiothreitol (CHEBI:18320) |
| L-1,4-dithiothreitol (CHEBI:42106) is a 1,4-dithiothreitol (CHEBI:18320) |
| IUPAC Name |
|---|
| rel-(2R,3R)-1,4-disulfanylbutane-2,3-diol |
| Synonyms | Source |
|---|---|
| 1,4-Dithiothreitol | KEGG COMPOUND |
| Cleland's reagent | NIST Chemistry WebBook |
| Dithiothreitol | KEGG COMPOUND |
| Dithiotreitol | ChemIDplus |
| DL-threo-1,4-Dimercapto-2,3-butanediol | ChemIDplus |
| DTL | ChEBI |
| UniProt Name | Source |
|---|---|
| 1,4-dithiothreitol | UniProt |
| Citations |
|---|