EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:42170 - D-1,4-dithiothreitol
| Formula | C4H10O2S2 |
| Net Charge | 0 |
| Average Mass | 154.256 |
| Monoisotopic Mass | 154.01222 |
| SMILES | O[C@H](CS)[C@H](O)CS |
| InChI | InChI=1S/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | VHJLVAABSRFDPM-QWWZWVQMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-1,4-dithiothreitol (CHEBI:42170) is a 1,4-dithiothreitol (CHEBI:18320) |
| D-1,4-dithiothreitol (CHEBI:42170) is enantiomer of L-1,4-dithiothreitol (CHEBI:42106) |
| Incoming Relation(s) |
| L-1,4-dithiothreitol (CHEBI:42106) is enantiomer of D-1,4-dithiothreitol (CHEBI:42170) |
| IUPAC Name |
|---|
| (2S,3S)-1,4-disulfanylbutane-2,3-diol |
| Synonyms | Source |
|---|---|
| (2S,3S)-1,4-dimercaptobutane-2,3-diol | PDBeChem |
| D-DTT | ChEBI |
| D-threo-1,4-dimercapto-2,3-butanediol | ChEBI |