EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10O2S2 |
| Net Charge | 0 |
| Average Mass | 154.256 |
| Monoisotopic Mass | 154.01222 |
| SMILES | O[C@@H](CS)[C@@H](O)CS |
| InChI | InChI=1S/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-1,4-dithiothreitol (CHEBI:42106) is a 1,4-dithiothreitol (CHEBI:18320) |
| L-1,4-dithiothreitol (CHEBI:42106) is enantiomer of D-1,4-dithiothreitol (CHEBI:42170) |
| Incoming Relation(s) |
| D-1,4-dithiothreitol (CHEBI:42170) is enantiomer of L-1,4-dithiothreitol (CHEBI:42106) |
| IUPAC Name |
|---|
| (2R,3R)-1,4-disulfanylbutane-2,3-diol |
| Synonyms | Source |
|---|---|
| 1,4-Dithiothreitol | KEGG COMPOUND |
| 2,3-DIHYDROXY-1,4-DITHIOBUTANE | PDBeChem |
| (2R,3R)-1,4-dimercaptobutane-2,3-diol | PDBeChem |
| DL-threo-1,4-Dimercapto-2,3-butanediol | KEGG COMPOUND |
| L-1,4-dithiothreitol | ChemIDplus |
| L-dithiothreitol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00265 | KEGG COMPOUND |
| Dithiothreitol | Wikipedia |
| DTT | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2036371 | Beilstein |
| Gmelin:2859 | Gmelin |
| CAS:16096-97-2 | ChemIDplus |
| CAS:3483-12-3 | KEGG COMPOUND |