EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:46632 - clonidine (amino form)
| Formula | C9H9Cl2N3 |
| Net Charge | 0 |
| Average Mass | 230.098 |
| Monoisotopic Mass | 229.01735 |
| SMILES | Clc1cccc(Cl)c1NC1=NCCN1 |
| InChI | InChI=1S/C9H9Cl2N3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14) |
| InChIKey | GJSURZIOUXUGAL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). |
| Applications: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clonidine (amino form) (CHEBI:46632) is a clonidine (CHEBI:46631) |
| clonidine (amino form) (CHEBI:46632) is a imidazoline (CHEBI:53094) |
| clonidine (amino form) (CHEBI:46632) is tautomer of clonidine (imino form) (CHEBI:3757) |
| Incoming Relation(s) |
| clonidine (imino form) (CHEBI:3757) is tautomer of clonidine (amino form) (CHEBI:46632) |
| IUPAC Name |
|---|
| N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine |
| Synonyms | Source |
|---|---|
| 2-(2,6-dichloroanilino)-1,3-diazacyclopentene-(2) | ChemIDplus |
| 2-(2,6-dichloroanilino)-2-imidazoline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0014714 | HMDB |
| LSM-4223 | LINCS |
| 704 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:883415 | Reaxys |
| CAS:4205-90-7 | ChemIDplus |