EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3757 - clonidine (imino form)
| Formula | C9H9Cl2N3 |
| Net Charge | 0 |
| Average Mass | 230.098 |
| Monoisotopic Mass | 229.01735 |
| SMILES | Clc1cccc(Cl)c1N=C1NCCN1 |
| InChI | InChI=1S/C9H9Cl2N3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14) |
| InChIKey | GJSURZIOUXUGAL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clonidine (imino form) (CHEBI:3757) is a clonidine (CHEBI:46631) |
| clonidine (imino form) (CHEBI:3757) is tautomer of clonidine (amino form) (CHEBI:46632) |
| Incoming Relation(s) |
| clonidine (amino form) (CHEBI:46632) is tautomer of clonidine (imino form) (CHEBI:3757) |
| IUPAC Name |
|---|
| 2,6-dichloro-N-imidazolidin-2-ylideneaniline |
| Synonyms | Source |
|---|---|
| 2-[(2,6-dichlorophenyl)imino]imidazoline | NIST Chemistry WebBook |
| 2,6-dichloro-N-2-imidazolidinylidenebenzenamine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Clonidine | Wikipedia |
| D00281 | KEGG DRUG |
| HMDB0014714 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:746076 | Reaxys |
| Beilstein:746077 | Beilstein |
| CAS:4205-90-7 | NIST Chemistry WebBook |