EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3757 - clonidine (imino form)
| Formula | C9H9Cl2N3 |
| Net Charge | 0 |
| Average Mass | 230.098 |
| Monoisotopic Mass | 229.01735 |
| SMILES | Clc1cccc(Cl)c1N=C1NCCN1 |
| InChI | InChI=1S/C9H9Cl2N3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14) |
| InChIKey | GJSURZIOUXUGAL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clonidine (imino form) (CHEBI:3757) is a clonidine (CHEBI:46631) |
| clonidine (imino form) (CHEBI:3757) is tautomer of clonidine (amino form) (CHEBI:46632) |
| Incoming Relation(s) |
| clonidine (amino form) (CHEBI:46632) is tautomer of clonidine (imino form) (CHEBI:3757) |
| IUPAC Name |
|---|
| 2,6-dichloro-N-imidazolidin-2-ylideneaniline |
| Synonyms | Source |
|---|---|
| 2-[(2,6-dichlorophenyl)imino]imidazoline | NIST Chemistry WebBook |
| 2,6-dichloro-N-2-imidazolidinylidenebenzenamine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| D00281 | KEGG DRUG |
| Clonidine | Wikipedia |
| HMDB0014714 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:746077 | Beilstein |
| Reaxys:746076 | Reaxys |
| CAS:4205-90-7 | NIST Chemistry WebBook |