EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4658 - disopyramide phosphate
| Formula | C21H29N3O.H3O4P |
| Net Charge | 0 |
| Average Mass | 437.477 |
| Monoisotopic Mass | 437.20796 |
| SMILES | CC(C)N(CCC(C(N)=O)(c1ccccc1)c1ccccn1)C(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C21H29N3O.H3O4P/c1-16(2)24(17(3)4)15-13-21(20(22)25,18-10-6-5-7-11-18)19-12-8-9-14-23-19;1-5(2,3)4/h5-12,14,16-17H,13,15H2,1-4H3,(H2,22,25);(H3,1,2,3,4) |
| InChIKey | CGDDQFMPGMYYQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| disopyramide phosphate (CHEBI:4658) has functional parent disopyramide (CHEBI:4657) |
| disopyramide phosphate (CHEBI:4658) has role anti-arrhythmia drug (CHEBI:38070) |
| disopyramide phosphate (CHEBI:4658) has role cardiovascular drug (CHEBI:35554) |
| disopyramide phosphate (CHEBI:4658) is a organic molecular entity (CHEBI:50860) |
| disopyramide phosphate (CHEBI:4658) is a organoammonium phosphate (CHEBI:37509) |
| disopyramide phosphate (CHEBI:4658) is a racemate (CHEBI:60911) |
| Synonyms | Source |
|---|---|
| Dirythmin sa | ChEMBL |
| Diso-duriles | ChEMBL |
| Disopyramide phosphate | KEGG COMPOUND |
| NSC-756744 | ChEMBL |
| Rythmodan | ChEMBL |
| SC-13957 | ChEMBL |
| Brand Names | Source |
|---|---|
| Dirythmin | ChEMBL |
| Dirythmin-sa | ChEMBL |
| Isomide cr | ChEMBL |
| Norpace | ChEMBL |
| Norpace cr | ChEMBL |
| Rythmodan ret | ChEMBL |
| Citations |
|---|