EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4657 - disopyramide
| Formula | C21H29N3O |
| Net Charge | 0 |
| Average Mass | 339.483 |
| Monoisotopic Mass | 339.23106 |
| SMILES | CC(C)N(CCC(C(N)=O)(c1ccccc1)c1ccccn1)C(C)C |
| InChI | InChI=1S/C21H29N3O/c1-16(2)24(17(3)4)15-13-21(20(22)25,18-10-6-5-7-11-18)19-12-8-9-14-23-19/h5-12,14,16-17H,13,15H2,1-4H3,(H2,22,25) |
| InChIKey | UVTNFZQICZKOEM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| disopyramide (CHEBI:4657) has role anti-arrhythmia drug (CHEBI:38070) |
| disopyramide (CHEBI:4657) is a monocarboxylic acid amide (CHEBI:29347) |
| disopyramide (CHEBI:4657) is a pyridines (CHEBI:26421) |
| disopyramide (CHEBI:4657) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| disopyramide phosphate (CHEBI:4658) has functional parent disopyramide (CHEBI:4657) |
| IUPAC Name |
|---|
| 4-(diisopropylamino)-2-phenyl-2-pyridin-2-ylbutanamide |
| INNs | Source |
|---|---|
| disopyramide | ChemIDplus |
| disopiramida | ChemIDplus |
| disopyramidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| alpha-(2-(Diisopropylamino)ethyl)-alpha-phenyl-2-pyridineacetamide | ChemIDplus |
| gamma-Diisopropylamino-alpha-phenyl-alpha-(2-pyridyl)butyramide | ChemIDplus |
| Citations |
|---|