EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22NO.Cl |
| Net Charge | 0 |
| Average Mass | 291.822 |
| Monoisotopic Mass | 291.13899 |
| SMILES | C[NH+](C)CCOC(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C17H21NO.ClH/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,17H,13-14H2,1-2H3;1H |
| InChIKey | PCHPORCSPXIHLZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. anti-allergic agent A drug used to treat allergic reactions. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. antiparkinson drug A drug used in the treatment of Parkinson's disease. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenhydramine hydrochloride (CHEBI:4637) has part diphenhydramine (CHEBI:4636) |
| diphenhydramine hydrochloride (CHEBI:4637) has role anti-allergic agent (CHEBI:50857) |
| diphenhydramine hydrochloride (CHEBI:4637) has role antiemetic (CHEBI:50919) |
| diphenhydramine hydrochloride (CHEBI:4637) has role antiparkinson drug (CHEBI:48407) |
| diphenhydramine hydrochloride (CHEBI:4637) has role antipruritic drug (CHEBI:59683) |
| diphenhydramine hydrochloride (CHEBI:4637) has role H1-receptor antagonist (CHEBI:37955) |
| diphenhydramine hydrochloride (CHEBI:4637) has role local anaesthetic (CHEBI:36333) |
| diphenhydramine hydrochloride (CHEBI:4637) has role muscarinic antagonist (CHEBI:48876) |
| diphenhydramine hydrochloride (CHEBI:4637) has role sedative (CHEBI:35717) |
| diphenhydramine hydrochloride (CHEBI:4637) is a hydrochloride (CHEBI:36807) |
| diphenhydramine hydrochloride (CHEBI:4637) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| 2-(diphenylmethoxy)-N,N-dimethylethanaminium chloride |
| Synonyms | Source |
|---|---|
| 2-(benzhydryloxy)-N,N-dimethylethylamine hydrochloride | ChemIDplus |
| 2-(diphenylmethoxy)-N,N-dimethylethanamine hydrochloride | IUPAC |
| diphenhydramine HCl | ChemIDplus |
| α-hydroxydiphenylmethane-β-dimethylaminoethyl ether hydrochloride | ChemIDplus |
| β-dimethylaminoethyl benzhydryl ether hydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D00669 | KEGG DRUG |
| DB01075 | DrugBank |
| Diphenhydramine_Hydrochloride | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3918132 | Beilstein |
| CAS:147-24-0 | KEGG DRUG |
| CAS:147-24-0 | ChemIDplus |