EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O8P |
| Net Charge | 0 |
| Average Mass | 308.183 |
| Monoisotopic Mass | 308.04095 |
| SMILES | O=c1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H13N2O8P/c12-5-3-8(11-2-1-7(13)10-9(11)14)19-6(5)4-18-20(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,10,13,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
| InChIKey | JSRLJPSBLDHEIO-SHYZEUOFSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dUMP (CHEBI:17622) has role Escherichia coli metabolite (CHEBI:76971) |
| dUMP (CHEBI:17622) has role metabolite (CHEBI:25212) |
| dUMP (CHEBI:17622) has role mouse metabolite (CHEBI:75771) |
| dUMP (CHEBI:17622) is a deoxyuridine phosphate (CHEBI:23641) |
| dUMP (CHEBI:17622) is a pyrimidine 2'-deoxyribonucleoside 5'-monophosphate (CHEBI:36995) |
| dUMP (CHEBI:17622) is conjugate acid of dUMP(2−) (CHEBI:246422) |
| Incoming Relation(s) |
| 2'-deoxy-5-(4,5-dihydroxypentyl)uridine 5'-monophosphate (CHEBI:132193) has functional parent dUMP (CHEBI:17622) |
| 5-carboxy-2'-deoxyuridine 5'-monophosphate (CHEBI:102517) has functional parent dUMP (CHEBI:17622) |
| 5,6-dihydroxy-2'-deoxyuridine 5'-monophosphate (CHEBI:132190) has functional parent dUMP (CHEBI:17622) |
| dUMP(2−) (CHEBI:246422) is conjugate base of dUMP (CHEBI:17622) |
| dUMP 3'-end residue (CHEBI:75715) is substituent group from dUMP (CHEBI:17622) |
| dUMP 5'-end residue (CHEBI:75716) is substituent group from dUMP (CHEBI:17622) |
| dUMP residue (CHEBI:75714) is substituent group from dUMP (CHEBI:17622) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-uridylic acid |
| Synonyms | Source |
|---|---|
| dUMP | KEGG COMPOUND |
| Deoxyuridylic acid | KEGG COMPOUND |
| Deoxyuridine monophosphate | KEGG COMPOUND |
| Deoxyuridine 5'-phosphate | KEGG COMPOUND |
| 2'-Deoxyuridine 5'-phosphate | KEGG COMPOUND |
| 2'-deoxyuridine 5'-monophosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00365 | KEGG COMPOUND |
| Deoxyuridine_monophosphate | Wikipedia |
| HMDB0001409 | HMDB |
| DUMP | MetaCyc |
| DU | PDBeChem |
| UMP | PDBeChem |
| DB03800 | DrugBank |
| C00019282 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:42143 | Reaxys |
| CAS:964-26-1 | KEGG COMPOUND |
| CAS:964-26-1 | ChemIDplus |
| Citations |
|---|