EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O8P |
| Net Charge | 0 |
| Average Mass | 308.183 |
| Monoisotopic Mass | 308.04095 |
| SMILES | O=c1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H13N2O8P/c12-5-3-8(11-2-1-7(13)10-9(11)14)19-6(5)4-18-20(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,10,13,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
| InChIKey | JSRLJPSBLDHEIO-SHYZEUOFSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dUMP (CHEBI:17622) has role Escherichia coli metabolite (CHEBI:76971) |
| dUMP (CHEBI:17622) has role metabolite (CHEBI:25212) |
| dUMP (CHEBI:17622) has role mouse metabolite (CHEBI:75771) |
| dUMP (CHEBI:17622) is a deoxyuridine phosphate (CHEBI:23641) |
| dUMP (CHEBI:17622) is a pyrimidine 2'-deoxyribonucleoside 5'-monophosphate (CHEBI:36995) |
| dUMP (CHEBI:17622) is conjugate acid of dUMP(2−) (CHEBI:246422) |
| Incoming Relation(s) |
| 2'-deoxy-5-(4,5-dihydroxypentyl)uridine 5'-monophosphate (CHEBI:132193) has functional parent dUMP (CHEBI:17622) |
| 5-carboxy-2'-deoxyuridine 5'-monophosphate (CHEBI:102517) has functional parent dUMP (CHEBI:17622) |
| 5,6-dihydroxy-2'-deoxyuridine 5'-monophosphate (CHEBI:132190) has functional parent dUMP (CHEBI:17622) |
| dUMP(2−) (CHEBI:246422) is conjugate base of dUMP (CHEBI:17622) |
| dUMP 3'-end residue (CHEBI:75715) is substituent group from dUMP (CHEBI:17622) |
| dUMP 5'-end residue (CHEBI:75716) is substituent group from dUMP (CHEBI:17622) |
| dUMP residue (CHEBI:75714) is substituent group from dUMP (CHEBI:17622) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-uridylic acid |
| Synonyms | Source |
|---|---|
| 2'-deoxyuridine 5'-monophosphate | ChEBI |
| 2'-Deoxyuridine 5'-phosphate | KEGG COMPOUND |
| Deoxyuridine 5'-phosphate | KEGG COMPOUND |
| Deoxyuridine monophosphate | KEGG COMPOUND |
| deoxyuridylate | ChEBI |
| Deoxyuridylic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00019282 | KNApSAcK |
| C00365 | KEGG COMPOUND |
| DB03800 | DrugBank |
| Deoxyuridine_monophosphate | Wikipedia |
| DU | PDBeChem |
| DUMP | MetaCyc |
| HMDB0001409 | HMDB |
| UMP | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:42143 | Reaxys |
| CAS:964-26-1 | ChemIDplus |
| CAS:964-26-1 | KEGG COMPOUND |
| Citations |
|---|