EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N2O8P |
| Net Charge | -2 |
| Average Mass | 306.167 |
| Monoisotopic Mass | 306.02640 |
| SMILES | O=c1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])[O-])O2)c(=O)n1 |
| InChI | InChI=1S/C9H13N2O8P/c12-5-3-8(11-2-1-7(13)10-9(11)14)19-6(5)4-18-20(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,10,13,14)(H2,15,16,17)/p-2/t5-,6+,8+/m0/s1 |
| InChIKey | JSRLJPSBLDHEIO-SHYZEUOFSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dUMP(2−) (CHEBI:246422) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| dUMP(2−) (CHEBI:246422) has role human metabolite (CHEBI:77746) |
| dUMP(2−) (CHEBI:246422) is a 2'-deoxynucleoside 5'-monophosphate(2−) (CHEBI:65317) |
| dUMP(2−) (CHEBI:246422) is a pyrimidine 2'-deoxyribonucleoside 5'-phosphate(2−) (CHEBI:142209) |
| dUMP(2−) (CHEBI:246422) is conjugate base of dUMP (CHEBI:17622) |
| Incoming Relation(s) |
| dUMP (CHEBI:17622) is conjugate acid of dUMP(2−) (CHEBI:246422) |
| dUMP residue(1−) (CHEBI:133902) is substituent group from dUMP(2−) (CHEBI:246422) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-O-phosphonatouridine |
| Synonyms | Source |
|---|---|
| deoxyuridine 5'-phosphate(2−) | ChEBI |
| deoxyuridine 5'-phosphate dianion | ChEBI |
| deoxyuridylate | ChEBI |
| dUMP dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| dUMP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:338416 | Gmelin |
| Beilstein:4011255 | Beilstein |