EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6O6 |
| Net Charge | 0 |
| Average Mass | 210.141 |
| Monoisotopic Mass | 210.01644 |
| SMILES | O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | QMKYBPDZANOJGF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzene-1,3,5-tricarboxylic acid (CHEBI:46032) is a benzoic acids (CHEBI:22723) |
| benzene-1,3,5-tricarboxylic acid (CHEBI:46032) is a tricarboxylic acid (CHEBI:27093) |
| benzene-1,3,5-tricarboxylic acid (CHEBI:46032) is conjugate acid of benzene-1,3,5-tricarboxylate(1−) (CHEBI:33061) |
| Incoming Relation(s) |
| N,N',N''-tris(3-pyridyl)benzene-1,3,5-tricarboxamide (CHEBI:52612) has functional parent benzene-1,3,5-tricarboxylic acid (CHEBI:46032) |
| benzene-1,3,5-tricarboxylate(1−) (CHEBI:33061) is conjugate base of benzene-1,3,5-tricarboxylic acid (CHEBI:46032) |
| IUPAC Name |
|---|
| benzene-1,3,5-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 1,3,5-BENZENETRICARBOXYLIC ACID | PDBeChem |
| 1,3,5-tricarboxybenzene | NIST Chemistry WebBook |
| 5-carboxyisophthalic acid | ChemIDplus |
| trimesic acid | ChemIDplus |
| trimesinic acid | NIST Chemistry WebBook |
| trimesitinic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| DB08632 | DrugBank |
| TMM | PDBeChem |
| Trimesic_acid | Wikipedia |
| Citations |
|---|