EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5O6 |
| Net Charge | -1 |
| Average Mass | 209.133 |
| Monoisotopic Mass | 209.00916 |
| SMILES | O=C([O-])c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15)/p-1 |
| InChIKey | QMKYBPDZANOJGF-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzene-1,3,5-tricarboxylate(1−) (CHEBI:33061) is a tricarboxylic acid monoanion (CHEBI:36299) |
| benzene-1,3,5-tricarboxylate(1−) (CHEBI:33061) is conjugate acid of benzene-1,3,5-tricarboxylate(2−) (CHEBI:33060) |
| benzene-1,3,5-tricarboxylate(1−) (CHEBI:33061) is conjugate base of benzene-1,3,5-tricarboxylic acid (CHEBI:46032) |
| Incoming Relation(s) |
| benzene-1,3,5-tricarboxylic acid (CHEBI:46032) is conjugate acid of benzene-1,3,5-tricarboxylate(1−) (CHEBI:33061) |
| benzene-1,3,5-tricarboxylate(2−) (CHEBI:33060) is conjugate base of benzene-1,3,5-tricarboxylate(1−) (CHEBI:33061) |
| IUPAC Name |
|---|
| 3,5-dicarboxybenzoate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1655379 | Gmelin |