EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24F3N3S |
| Net Charge | 0 |
| Average Mass | 407.505 |
| Monoisotopic Mass | 407.16430 |
| SMILES | CN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C21H24F3N3S/c1-25-11-13-26(14-12-25)9-4-10-27-17-5-2-3-6-19(17)28-20-8-7-16(15-18(20)27)21(22,23)24/h2-3,5-8,15H,4,9-14H2,1H3 |
| InChIKey | ZEWQUBUPAILYHI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor An EC 1.8.1.* (oxidoreductase acting on sulfur group of donors, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of trypanothione-disulfide reductase (EC 1.8.1.12). EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor An EC 5.3.3.* (intramolecular oxidase transposing C=C bonds) inhibitor that interferes with the action of a cholestenol Δ-isomerase (EC 5.3.3.5). calmodulin antagonist An antagonist that interferes with the action of the calcium-binding messenger protein calmodulin. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trifluoperazine (CHEBI:45951) has role antiemetic (CHEBI:50919) |
| trifluoperazine (CHEBI:45951) has role calmodulin antagonist (CHEBI:130181) |
| trifluoperazine (CHEBI:45951) has role dopaminergic antagonist (CHEBI:48561) |
| trifluoperazine (CHEBI:45951) has role EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor (CHEBI:77402) |
| trifluoperazine (CHEBI:45951) has role EC 5.3.3.5 (cholestenol Δ-isomerase) inhibitor (CHEBI:86385) |
| trifluoperazine (CHEBI:45951) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| trifluoperazine (CHEBI:45951) is a N-alkylpiperazine (CHEBI:46845) |
| trifluoperazine (CHEBI:45951) is a N-methylpiperazine (CHEBI:46920) |
| trifluoperazine (CHEBI:45951) is a organofluorine compound (CHEBI:37143) |
| trifluoperazine (CHEBI:45951) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| trifluoperazine dimaleate (CHEBI:32259) has part trifluoperazine (CHEBI:45951) |
| trifluoperazine hydrochloride (CHEBI:9710) has part trifluoperazine (CHEBI:45951) |
| IUPAC Name |
|---|
| 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-10H-phenothiazine |
| INNs | Source |
|---|---|
| trifluoperazina | ChemIDplus |
| trifluoperazine | KEGG DRUG |
| trifluopérazine | ChEBI |
| trifluoperazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10-[3-(4-methyl-1-piperazinyl)propyl]-2-(trifluoromethyl)-10H-phenothiazine | NIST Chemistry WebBook |
| 10-[3-(4-METHYL-PIPERAZIN-1-YL)-PROPYL]-2-TRIFLUOROMETHYL-10H-PHENOTHIAZINE | PDBeChem |
| Trifluoperazine | KEGG COMPOUND |
| trifluoromethyl-10-(3'-(1-methyl-4-piperazinyl)propyl)phenothiazine | NIST Chemistry WebBook |
| trifluoroperazine | NIST Chemistry WebBook |
| trifluperazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2740 | DrugCentral |
| C07168 | KEGG COMPOUND |
| D08636 | KEGG DRUG |
| DB00831 | DrugBank |
| HMDB0014969 | HMDB |
| LSM-4010 | LINCS |
| TFP | PDBeChem |
| Trifluoperazine | Wikipedia |
| Citations |
|---|