EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:45951 - trifluoperazine
| Formula | C21H24F3N3S |
| Net Charge | 0 |
| Average Mass | 407.505 |
| Monoisotopic Mass | 407.16430 |
| SMILES | CN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C21H24F3N3S/c1-25-11-13-26(14-12-25)9-4-10-27-17-5-2-3-6-19(17)28-20-8-7-16(15-18(20)27)21(22,23)24/h2-3,5-8,15H,4,9-14H2,1H3 |
| InChIKey | ZEWQUBUPAILYHI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor An EC 1.8.1.* (oxidoreductase acting on sulfur group of donors, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of trypanothione-disulfide reductase (EC 1.8.1.12). dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. calmodulin antagonist An antagonist that interferes with the action of the calcium-binding messenger protein calmodulin. EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor An EC 5.3.3.* (intramolecular oxidase transposing C=C bonds) inhibitor that interferes with the action of a cholestenol Δ-isomerase (EC 5.3.3.5). |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trifluoperazine (CHEBI:45951) has role anti-anaemic agent (CHEBI:75835) |
| trifluoperazine (CHEBI:45951) has role antiemetic (CHEBI:50919) |
| trifluoperazine (CHEBI:45951) has role antipsychotic agent (CHEBI:35476) |
| trifluoperazine (CHEBI:45951) has role calmodulin antagonist (CHEBI:130181) |
| trifluoperazine (CHEBI:45951) has role dopaminergic antagonist (CHEBI:48561) |
| trifluoperazine (CHEBI:45951) has role EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor (CHEBI:77402) |
| trifluoperazine (CHEBI:45951) has role EC 5.3.3.5 (cholestenol Δ-isomerase) inhibitor (CHEBI:86385) |
| trifluoperazine (CHEBI:45951) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| trifluoperazine (CHEBI:45951) is a N-alkylpiperazine (CHEBI:46845) |
| trifluoperazine (CHEBI:45951) is a N-methylpiperazine (CHEBI:46920) |
| trifluoperazine (CHEBI:45951) is a organofluorine compound (CHEBI:37143) |
| trifluoperazine (CHEBI:45951) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| trifluoperazine dimaleate (CHEBI:32259) has part trifluoperazine (CHEBI:45951) |
| trifluoperazine hydrochloride (CHEBI:9710) has part trifluoperazine (CHEBI:45951) |
| IUPAC Name |
|---|
| 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-10H-phenothiazine |
| INNs | Source |
|---|---|
| trifluoperazina | ChemIDplus |
| trifluoperazine | KEGG DRUG |
| trifluopérazine | ChEBI |
| trifluoperazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10-[3-(4-methyl-1-piperazinyl)propyl]-2-(trifluoromethyl)-10H-phenothiazine | NIST Chemistry WebBook |
| 10-[3-(4-METHYL-PIPERAZIN-1-YL)-PROPYL]-2-TRIFLUOROMETHYL-10H-PHENOTHIAZINE | PDBeChem |
| Apo-trifluoperazine | ChEMBL |
| Flurazine | ChEMBL |
| NSC-17474 | ChEMBL |
| NSC-46061 | ChEMBL |
| Brand Names | Source |
|---|---|
| Amylozine | ChEMBL |
| Stelazine | ChEMBL |
| Stelazine fte | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2740 | DrugCentral |
| C07168 | KEGG COMPOUND |
| D08636 | KEGG DRUG |
| DB00831 | DrugBank |
| HMDB0014969 | HMDB |
| LSM-4010 | LINCS |
| TFP | PDBeChem |
| Trifluoperazine | Wikipedia |
| Citations |
|---|