EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O6 |
| Net Charge | 0 |
| Average Mass | 148.070 |
| Monoisotopic Mass | 148.00079 |
| SMILES | O=C(O)/C(O)=C(\O)C(=O)O |
| InChI | InChI=1S/C4H4O6/c5-1(3(7)8)2(6)4(9)10/h5-6H,(H,7,8)(H,9,10)/b2-1+ |
| InChIKey | BZCOSCNPHJNQBP-OWOJBTEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroxyfumaric acid (CHEBI:4593) has functional parent fumaric acid (CHEBI:18012) |
| dihydroxyfumaric acid (CHEBI:4593) is a 2-hydroxydicarboxylic acid (CHEBI:50263) |
| dihydroxyfumaric acid (CHEBI:4593) is a C4-dicarboxylic acid (CHEBI:66873) |
| dihydroxyfumaric acid (CHEBI:4593) is conjugate acid of dihydroxyfumarate(2−) (CHEBI:17795) |
| Incoming Relation(s) |
| dihydroxyfumarate(2−) (CHEBI:17795) is conjugate base of dihydroxyfumaric acid (CHEBI:4593) |
| IUPAC Name |
|---|
| (2E)-2,3-dihydroxybut-2-enedioic acid |
| Synonyms | Source |
|---|---|
| 2,3-dihydroxyfumaric acid | ChEBI |
| 2-oxo-3,4,4-trihydroxy-3E-butenoic acid | LIPID MAPS |
| Dihydroxyfumaric acid | KEGG COMPOUND |
| Dihydroxyfumarsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00975 | KEGG COMPOUND |
| LMFA01060194 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1125748 | Gmelin |
| Reaxys:1724790 | Reaxys |
| CAS:133-38-0 | KEGG COMPOUND |
| CAS:133-38-0 | ChemIDplus |