EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H2O6 |
| Net Charge | -2 |
| Average Mass | 146.054 |
| Monoisotopic Mass | 145.98623 |
| SMILES | O=C([O-])/C(O)=C(\O)C(=O)[O-] |
| InChI | InChI=1S/C4H4O6/c5-1(3(7)8)2(6)4(9)10/h5-6H,(H,7,8)(H,9,10)/p-2/b2-1+ |
| InChIKey | BZCOSCNPHJNQBP-OWOJBTEDSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroxyfumarate(2−) (CHEBI:17795) has functional parent fumarate(2−) (CHEBI:29806) |
| dihydroxyfumarate(2−) (CHEBI:17795) is a C4-dicarboxylate (CHEBI:61336) |
| dihydroxyfumarate(2−) (CHEBI:17795) is conjugate base of dihydroxyfumaric acid (CHEBI:4593) |
| Incoming Relation(s) |
| dihydroxyfumaric acid (CHEBI:4593) is conjugate acid of dihydroxyfumarate(2−) (CHEBI:17795) |
| IUPAC Name |
|---|
| (2E)-2,3-dihydroxybut-2-enedioate |
| UniProt Name | Source |
|---|---|
| dihydroxyfumarate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00975 | KEGG COMPOUND |