EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4581 - 7,8-dihydropteroic acid
| Formula | C14H14N6O3 |
| Net Charge | 0 |
| Average Mass | 314.305 |
| Monoisotopic Mass | 314.11274 |
| SMILES | Nc1nc2c(c(=O)n1)N=C(CNc1ccc(C(=O)O)cc1)CN2 |
| InChI | InChI=1S/C14H14N6O3/c15-14-19-11-10(12(21)20-14)18-9(6-17-11)5-16-8-3-1-7(2-4-8)13(22)23/h1-4,16H,5-6H2,(H,22,23)(H4,15,17,19,20,21) |
| InChIKey | WBFYVDCHGVNRBH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-dihydropteroic acid (CHEBI:4581) has functional parent pteroic acid (CHEBI:38794) |
| 7,8-dihydropteroic acid (CHEBI:4581) is a pteroic acids (CHEBI:38795) |
| 7,8-dihydropteroic acid (CHEBI:4581) is conjugate acid of 7,8-dihydropteroate (CHEBI:17839) |
| Incoming Relation(s) |
| 2-hydroxy-7,8-dihydropteroic acid (CHEBI:138237) has functional parent 7,8-dihydropteroic acid (CHEBI:4581) |
| 7,8-dihydropteroate (CHEBI:17839) is conjugate base of 7,8-dihydropteroic acid (CHEBI:4581) |
| IUPAC Name |
|---|
| 4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}benzoic acid |
| Synonyms | Source |
|---|---|
| 4-(((2-amino-1,4,7,8-tetrahydro-4-oxo-6-pteridinyl)methyl)amino)benzoic acid | ChemIDplus |
| 7,8-Dihydropteroate | KEGG COMPOUND |
| Dihydropteroate | KEGG COMPOUND |
| Dihydropteroinsäure | ChEBI |