EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N6O4 |
| Net Charge | 0 |
| Average Mass | 330.304 |
| Monoisotopic Mass | 330.10765 |
| SMILES | Nc1nc2c(c(=O)n1)N=C(CNc1ccc(C(=O)O)c(O)c1)CN2 |
| InChI | InChI=1S/C14H14N6O4/c15-14-19-11-10(12(22)20-14)18-7(5-17-11)4-16-6-1-2-8(13(23)24)9(21)3-6/h1-3,16,21H,4-5H2,(H,23,24)(H4,15,17,19,20,22) |
| InChIKey | GIQHIMWSWCCNJG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycobacterium tuberculosis (ncbitaxon:1773) | - | PubMed (23118010) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-7,8-dihydropteroic acid (CHEBI:138237) has functional parent 7,8-dihydropteroic acid (CHEBI:4581) |
| 2-hydroxy-7,8-dihydropteroic acid (CHEBI:138237) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2-hydroxy-7,8-dihydropteroic acid (CHEBI:138237) is a monohydroxybenzoic acid (CHEBI:25389) |
| 2-hydroxy-7,8-dihydropteroic acid (CHEBI:138237) is a pteroic acids (CHEBI:38795) |
| IUPAC Name |
|---|
| 4-{[(2-amino-4-oxo-1,4,7,8-tetrahydropteridin-6-yl)methyl]amino}-2-hydroxybenzoic acid |
| Synonym | Source |
|---|---|
| H2PtePAS | ChEBI |
| Citations |
|---|