EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H67NO15 |
| Net Charge | 0 |
| Average Mass | 813.979 |
| Monoisotopic Mass | 813.45107 |
| SMILES | CO[C@H]1C[C@H](O[C@H]2[C@H](C)[C@@H](O[C@@H]3O[C@H](C)C[C@H](N(C)C)[C@H]3OC(C)=O)[C@@H](C)C[C@@]3(CO3)C(=O)[C@H](C)[C@@H](OC(C)=O)[C@@H](C)[C@@H](C)OC(=O)[C@@H]2C)O[C@@H](C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C41H67NO15/c1-19-17-41(18-49-41)38(46)23(5)34(53-27(9)43)21(3)25(7)52-39(47)24(6)35(56-32-16-31(48-14)36(26(8)51-32)54-28(10)44)22(4)33(19)57-40-37(55-29(11)45)30(42(12)13)15-20(2)50-40/h19-26,30-37,40H,15-18H2,1-14H3/t19-,20+,21-,22+,23+,24+,25+,26-,30-,31-,32-,33-,34-,35-,36-,37+,40-,41+/m0/s1 |
| InChIKey | LQCLVBQBTUVCEQ-QTFUVMRISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 1.14.13.97 (taurochenodeoxycholate 6alpha-hydroxylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.97 (taurochenodeoxycholate 6α-hydroxylase). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| troleandomycin (CHEBI:45735) has functional parent oleandomycin (CHEBI:16869) |
| troleandomycin (CHEBI:45735) has role EC 1.14.13.97 (taurochenodeoxycholate 6α-hydroxylase) inhibitor (CHEBI:86501) |
| troleandomycin (CHEBI:45735) has role xenobiotic (CHEBI:35703) |
| troleandomycin (CHEBI:45735) is a acetate ester (CHEBI:47622) |
| troleandomycin (CHEBI:45735) is a epoxide (CHEBI:32955) |
| troleandomycin (CHEBI:45735) is a macrolide antibiotic (CHEBI:25105) |
| troleandomycin (CHEBI:45735) is a monosaccharide derivative (CHEBI:63367) |
| troleandomycin (CHEBI:45735) is a polyketide (CHEBI:26188) |
| troleandomycin (CHEBI:45735) is a semisynthetic derivative (CHEBI:72588) |
| IUPAC Name |
|---|
| (3R,5R,6S,7R,8R,11R,12S,13R,14S,15S)-12-[(4-O-acetyl-2,6-dideoxy-3-O-methyl-α-L-arabino-hexopyranosyl)oxy]-14-{[2-O-acetyl-3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy}-5,7,8,11,13,15-hexamethyl-4,10-dioxo-1,9-dioxaspiro[2.13]hexadecan-6-yl acetate |
| INNs | Source |
|---|---|
| troleandomycin | KEGG DRUG |
| troleandomicina | ChemIDplus |
| troleandomycinum | ChemIDplus |
| troleandomycine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Triacetyloleandomycin | KEGG COMPOUND |
| Oleandomycin triacetate | HMDB |
| Oleandomycin triacetyl ester | HMDB |
| Oleandocetine | HMDB |
| Tribiocillina | ChemIDplus |
| Triacetyloleandomycinum | ChemIDplus |
| Brand Name | Source |
|---|---|
| Triocetin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12753 | KEGG COMPOUND |
| TAO | PDBeChem |
| D01322 | KEGG DRUG |
| DB01361 | DrugBank |
| LMPK04000042 | LIPID MAPS |
| HMDB0015448 | HMDB |
| Troleandomycin | Wikipedia |
| LSM-5510 | LINCS |
| 2769 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:77547 | Reaxys |
| CAS:2751-09-9 | KEGG COMPOUND |
| CAS:2751-09-9 | ChemIDplus |
| Citations |
|---|