EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H61NO12 |
| Net Charge | 0 |
| Average Mass | 687.868 |
| Monoisotopic Mass | 687.41938 |
| SMILES | CO[C@H]1C[C@H](O[C@H]2[C@H](C)[C@@H](O[C@@H]3O[C@H](C)C[C@H](N(C)C)[C@H]3O)[C@@H](C)C[C@@]3(CO3)C(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@@H](C)OC(=O)[C@@H]2C)O[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C35H61NO12/c1-16-14-35(15-43-35)32(40)19(4)27(37)18(3)22(7)46-33(41)21(6)31(47-26-13-25(42-11)28(38)23(8)45-26)20(5)30(16)48-34-29(39)24(36(9)10)12-17(2)44-34/h16-31,34,37-39H,12-15H2,1-11H3/t16-,17+,18-,19+,20+,21+,22+,23-,24-,25-,26-,27-,28-,29+,30-,31-,34-,35+/m0/s1 |
| InChIKey | RZPAKFUAFGMUPI-QESOVKLGSA-N |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleandomycin (CHEBI:16869) has functional parent oleandolide (CHEBI:29658) |
| oleandomycin (CHEBI:16869) is a oleandomycins (CHEBI:25661) |
| oleandomycin (CHEBI:16869) is conjugate base of oleandomycin(1+) (CHEBI:57933) |
| Incoming Relation(s) |
| oleandomycin 2'-O-phosphate (CHEBI:16021) has functional parent oleandomycin (CHEBI:16869) |
| oleandomycin 2'-O-phosphate(1−) (CHEBI:57607) has functional parent oleandomycin (CHEBI:16869) |
| troleandomycin (CHEBI:45735) has functional parent oleandomycin (CHEBI:16869) |
| oleandomycin(1+) (CHEBI:57933) is conjugate acid of oleandomycin (CHEBI:16869) |
| IUPAC Name |
|---|
| (3R,5R,6S,7R,8R,11R,12S,13R,14S,15S)-6-hydroxy-5,7,8,11,13,15-hexamethyl-4,10-dioxo-14-[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyloxy]-1,9-dioxaspiro[2.13]hexadec-12-yl 2,6-dideoxy-3-O-methyl-α-L-arabino-hexopyranoside |
| Synonyms | Source |
|---|---|
| Amimycin | KEGG COMPOUND |
| Landomycin | KEGG COMPOUND |
| Matromycin | KEGG COMPOUND |
| Oleandomycin | KEGG COMPOUND |
| Romicil | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1983 | DrugCentral |
| C01946 | KEGG COMPOUND |
| C01946 | KEGG COMPOUND |
| LMPK04000007 | LIPID MAPS |
| OLEANDOMYCIN | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Beilstein:74476 | Beilstein |
| CAS:3922-90-5 | KEGG COMPOUND |
| CAS:3922-90-5 | ChemIDplus |