EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O8 |
| Net Charge | 0 |
| Average Mass | 444.440 |
| Monoisotopic Mass | 444.15327 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C22H24N2O8/c1-21(31)8-5-4-6-11(25)12(8)16(26)13-9(21)7-10-15(24(2)3)17(27)14(20(23)30)19(29)22(10,32)18(13)28/h4-6,9-10,15,25,27-28,31-32H,7H2,1-3H3,(H2,23,30)/t9-,10-,15-,21+,22-/m0/s1 |
| InChIKey | OFVLGDICTFRJMM-WESIUVDSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antibacterial drug A drug used to treat or prevent bacterial infections. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antibacterial drug A drug used to treat or prevent bacterial infections. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetracycline (CHEBI:27902) has role Escherichia coli metabolite (CHEBI:76971) |
| tetracycline (CHEBI:27902) has role antibacterial agent (CHEBI:33282) |
| tetracycline (CHEBI:27902) has role antibacterial drug (CHEBI:36047) |
| tetracycline (CHEBI:27902) has role antifungal drug (CHEBI:86327) |
| tetracycline (CHEBI:27902) has role antiinfective agent (CHEBI:35441) |
| tetracycline (CHEBI:27902) has role antimicrobial agent (CHEBI:33281) |
| tetracycline (CHEBI:27902) has role antineoplastic agent (CHEBI:35610) |
| tetracycline (CHEBI:27902) has role antiprotozoal drug (CHEBI:35820) |
| tetracycline (CHEBI:27902) has role immunosuppressive agent (CHEBI:35705) |
| tetracycline (CHEBI:27902) has role ophthalmology drug (CHEBI:66981) |
| tetracycline (CHEBI:27902) has role protein synthesis inhibitor (CHEBI:48001) |
| tetracycline (CHEBI:27902) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| tetracycline (CHEBI:27902) is a tetracyclines (CHEBI:26895) |
| tetracycline (CHEBI:27902) is tautomer of tetracycline zwitterion (CHEBI:77932) |
| Incoming Relation(s) |
| 11a-hydroxytetracycline (CHEBI:134017) has functional parent tetracycline (CHEBI:27902) |
| tetracycline zwitterion (CHEBI:77932) is tautomer of tetracycline (CHEBI:27902) |
| IUPAC Name |
|---|
| (4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| tetraciclina | WHO MedNet |
| tetracycline | ChemIDplus |
| tetracyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (4S,4aS,5aS,12aS)-4-(Dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-2-naphthacenecarboxamide | ChemIDplus |
| Abramycin | ChemIDplus |
| Anhydrotetracycline | DrugBank |
| Deschlorobiomycin | ChemIDplus |
| E701 | ChEMBL |
| Liquamycin | ChemIDplus |
| Brand Names | Source |
|---|---|
| Achromycin | ChEBI |
| Achromycin v | ChEMBL |
| Economycin | ChEMBL |
| Panmycin | ChEMBL |
| Supramycin | ChEMBL |
| Sustamycin | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1103368 | Gmelin |
| Reaxys:2230417 | Reaxys |
| CAS:60-54-8 | KEGG COMPOUND |
| CAS:60-54-8 | ChemIDplus |
| Citations |
|---|