EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O8 |
| Net Charge | 0 |
| Average Mass | 444.440 |
| Monoisotopic Mass | 444.15327 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C22H24N2O8/c1-21(31)8-5-4-6-11(25)12(8)16(26)13-9(21)7-10-15(24(2)3)17(27)14(20(23)30)19(29)22(10,32)18(13)28/h4-6,9-10,15,25,27-28,31-32H,7H2,1-3H3,(H2,23,30)/t9-,10-,15-,21+,22-/m0/s1 |
| InChIKey | OFVLGDICTFRJMM-WESIUVDSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetracycline (CHEBI:27902) has role Escherichia coli metabolite (CHEBI:76971) |
| tetracycline (CHEBI:27902) has role antibacterial drug (CHEBI:36047) |
| tetracycline (CHEBI:27902) has role antimicrobial agent (CHEBI:33281) |
| tetracycline (CHEBI:27902) has role antiprotozoal drug (CHEBI:35820) |
| tetracycline (CHEBI:27902) has role protein synthesis inhibitor (CHEBI:48001) |
| tetracycline (CHEBI:27902) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| tetracycline (CHEBI:27902) is a tetracyclines (CHEBI:26895) |
| tetracycline (CHEBI:27902) is tautomer of tetracycline zwitterion (CHEBI:77932) |
| Incoming Relation(s) |
| 11a-hydroxytetracycline (CHEBI:134017) has functional parent tetracycline (CHEBI:27902) |
| tetracycline zwitterion (CHEBI:77932) is tautomer of tetracycline (CHEBI:27902) |
| IUPAC Name |
|---|
| (4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| tetracyclinum | ChemIDplus |
| tetracycline | ChemIDplus |
| Synonyms | Source |
|---|---|
| Tetracycline | KEGG COMPOUND |
| (4S,4aS,5aS,12aS)-4-(Dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-2-naphthacenecarboxamide | ChemIDplus |
| Deschlorobiomycin | ChemIDplus |
| Tsiklomitsin | ChemIDplus |
| Abramycin | ChemIDplus |
| Liquamycin | ChemIDplus |
| Brand Name | Source |
|---|---|
| Achromycin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1103368 | Gmelin |
| Reaxys:2230417 | Reaxys |
| CAS:60-54-8 | ChemIDplus |
| CAS:60-54-8 | KEGG COMPOUND |
| Citations |
|---|