EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O8 |
| Net Charge | 0 |
| Average Mass | 444.440 |
| Monoisotopic Mass | 444.15327 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H]([NH+](C)C)C([O-])=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C22H24N2O8/c1-21(31)8-5-4-6-11(25)12(8)16(26)13-9(21)7-10-15(24(2)3)17(27)14(20(23)30)19(29)22(10,32)18(13)28/h4-6,9-10,15,25,27-28,31-32H,7H2,1-3H3,(H2,23,30)/t9-,10-,15-,21+,22-/m0/s1 |
| InChIKey | OFVLGDICTFRJMM-WESIUVDSSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetracycline zwitterion (CHEBI:77932) has role antibacterial drug (CHEBI:36047) |
| tetracycline zwitterion (CHEBI:77932) has role antimicrobial agent (CHEBI:33281) |
| tetracycline zwitterion (CHEBI:77932) has role antiprotozoal drug (CHEBI:35820) |
| tetracycline zwitterion (CHEBI:77932) has role protein synthesis inhibitor (CHEBI:48001) |
| tetracycline zwitterion (CHEBI:77932) is a a tetracycline zwitterion (CHEBI:144644) |
| tetracycline zwitterion (CHEBI:77932) is a zwitterion (CHEBI:27369) |
| tetracycline zwitterion (CHEBI:77932) is conjugate acid of tetracycline(1−) (CHEBI:71392) |
| tetracycline zwitterion (CHEBI:77932) is tautomer of tetracycline (CHEBI:27902) |
| Incoming Relation(s) |
| tetracycline(1−) (CHEBI:71392) is conjugate base of tetracycline zwitterion (CHEBI:77932) |
| tetracycline (CHEBI:27902) is tautomer of tetracycline zwitterion (CHEBI:77932) |
| IUPAC Name |
|---|
| (1S,4aS,11S,11aS,12aS)-3-carbamoyl-1-(dimethylazaniumyl)-4a,5,7,11-tetrahydroxy-11-methyl-4,6-dioxo-1,4,4a,6,11,11a,12,12a-octahydrotetracen-2-olate |
| UniProt Name | Source |
|---|---|
| tetracycline | UniProt |