EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O3 |
| Net Charge | 0 |
| Average Mass | 228.247 |
| Monoisotopic Mass | 228.07864 |
| SMILES | Oc1ccc(/C=C/c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1+ |
| InChIKey | LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arachis hypogaea (ncbitaxon:3818) | seed (BTO:0001226) | PubMed (21348467) | |
| Vitis vinifera (ncbitaxon:29760) | - | PubMed (11408943) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | phytoalexin A toxin made by a plant that acts against an organism attacking it. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. quorum sensing inhibitor Any compound that interferes with bacterial communication (quorum sensing, QS). glioma-associated oncogene inhibitor An inhibitor of any of the glioma-associated oncogene (GLI) proteins. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-resveratrol (CHEBI:45713) has role antioxidant (CHEBI:22586) |
| trans-resveratrol (CHEBI:45713) has role phytoalexin (CHEBI:26115) |
| trans-resveratrol (CHEBI:45713) has role plant metabolite (CHEBI:76924) |
| trans-resveratrol (CHEBI:45713) has role quorum sensing inhibitor (CHEBI:138977) |
| trans-resveratrol (CHEBI:45713) has role radical scavenger (CHEBI:48578) |
| trans-resveratrol (CHEBI:45713) is a resveratrol (CHEBI:27881) |
| Incoming Relation(s) |
| (+)-trans-ε-viniferin (CHEBI:76137) has functional parent trans-resveratrol (CHEBI:45713) |
| (E)-trans-miyabenol C (CHEBI:76193) has functional parent trans-resveratrol (CHEBI:45713) |
| (−)-trans-ε-viniferin (CHEBI:10556) has functional parent trans-resveratrol (CHEBI:45713) |
| (2R,3R)-trans-δ-viniferin (CHEBI:76147) has functional parent trans-resveratrol (CHEBI:45713) |
| (2R,3S)-trans-ε-viniferin (CHEBI:76143) has functional parent trans-resveratrol (CHEBI:45713) |
| (2S,3R)-trans-ε-viniferin (CHEBI:76140) has functional parent trans-resveratrol (CHEBI:45713) |
| (2S,3S)-trans-δ-viniferin (CHEBI:76141) has functional parent trans-resveratrol (CHEBI:45713) |
| trans-diptoindonesin B (CHEBI:76196) has functional parent trans-resveratrol (CHEBI:45713) |
| trans-piceid (CHEBI:8198) has functional parent trans-resveratrol (CHEBI:45713) |
| 3-methoxy-4',5-dihydroxy-trans-stilbene (CHEBI:63672) has functional parent trans-resveratrol (CHEBI:45713) |
| 4'-O-methyl-trans-resveratrol (CHEBI:232084) has functional parent trans-resveratrol (CHEBI:45713) |
| resveratrol-3-O-sulfate (CHEBI:84040) has functional parent trans-resveratrol (CHEBI:45713) |
| IUPAC Name |
|---|
| 5-[(1E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| Synonyms | Source |
|---|---|
| 3,4',5-stilbenetriol | ChemIDplus |
| 3,4',5-trihydroxy-trans-stilbene | MetaCyc |
| 3,4',5-trihydroxystilbene | ChemIDplus |
| 3,5,4'-trihydroxystilbene | ChemIDplus |
| 5-[(E)-2-(4-hydroxyphenyl)vinyl]benzene-1,3-diol | PDBeChem |
| (E)-5-(2-(4-hydroxyphenyl)ethenyl)-1,3-benzenediol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| trans-resveratrol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00002903 | KNApSAcK |
| C03582 | KEGG COMPOUND |
| CPD-83 | MetaCyc |
| DB02709 | DrugBank |
| HMDB0003747 | HMDB |
| LMPK13090005 | LIPID MAPS |
| Resveratrol | Wikipedia |
| STL | PDBeChem |
| Citations |
|---|