EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H22O6 |
| Net Charge | 0 |
| Average Mass | 454.478 |
| Monoisotopic Mass | 454.14164 |
| SMILES | Oc1ccc(/C=C/c2cc(O)cc3c2[C@@H](c2cc(O)cc(O)c2)[C@@H](c2ccc(O)cc2)O3)cc1 |
| InChI | InChI=1S/C28H22O6/c29-20-7-2-16(3-8-20)1-4-18-11-24(33)15-25-26(18)27(19-12-22(31)14-23(32)13-19)28(34-25)17-5-9-21(30)10-6-17/h1-15,27-33H/b4-1+/t27-,28-/m1/s1 |
| InChIKey | FQWLMRXWKZGLFI-VYEPLGKGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3R)-trans-ε-viniferin (CHEBI:76140) has functional parent trans-resveratrol (CHEBI:45713) |
| (2S,3R)-trans-ε-viniferin (CHEBI:76140) is a 1-benzofurans (CHEBI:38830) |
| (2S,3R)-trans-ε-viniferin (CHEBI:76140) is a polyphenol (CHEBI:26195) |
| (2S,3R)-trans-ε-viniferin (CHEBI:76140) is a stilbenoid (CHEBI:26776) |
| (2S,3R)-trans-ε-viniferin (CHEBI:76140) is enantiomer of (2R,3S)-trans-ε-viniferin (CHEBI:76143) |
| Incoming Relation(s) |
| (2R,3S)-trans-ε-viniferin (CHEBI:76143) is enantiomer of (2S,3R)-trans-ε-viniferin (CHEBI:76140) |
| IUPAC Name |
|---|
| 5-{(2S,3R)-6-hydroxy-2-(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-3-yl}benzene-1,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8659968 | Reaxys |