EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8198 - trans-piceid
| Formula | C20H22O8 |
| Net Charge | 0 |
| Average Mass | 390.388 |
| Monoisotopic Mass | 390.13147 |
| SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc(/C=C/c3ccc(O)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H22O8/c21-10-16-17(24)18(25)19(26)20(28-16)27-15-8-12(7-14(23)9-15)2-1-11-3-5-13(22)6-4-11/h1-9,16-26H,10H2/b2-1+/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | HSTZMXCBWJGKHG-CUYWLFDKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. hepatoprotective agent Any compound that is able to prevent damage to the liver. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-piceid (CHEBI:8198) has functional parent trans-resveratrol (CHEBI:45713) |
| trans-piceid (CHEBI:8198) has role anti-arrhythmia drug (CHEBI:38070) |
| trans-piceid (CHEBI:8198) has role antioxidant (CHEBI:22586) |
| trans-piceid (CHEBI:8198) has role geroprotector (CHEBI:176497) |
| trans-piceid (CHEBI:8198) has role hepatoprotective agent (CHEBI:62868) |
| trans-piceid (CHEBI:8198) has role metabolite (CHEBI:25212) |
| trans-piceid (CHEBI:8198) has role nephroprotective agent (CHEBI:76595) |
| trans-piceid (CHEBI:8198) has role potassium channel modulator (CHEBI:50510) |
| trans-piceid (CHEBI:8198) is a monosaccharide derivative (CHEBI:63367) |
| trans-piceid (CHEBI:8198) is a polyphenol (CHEBI:26195) |
| trans-piceid (CHEBI:8198) is a stilbenoid (CHEBI:26776) |
| trans-piceid (CHEBI:8198) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Piceid | KEGG COMPOUND |
| Polydatin | KEGG COMPOUND |
| 3,4,5-Trihydroxystilbene-3-beta-monoglucoside | KEGG COMPOUND |
| trans-resveratrol 3-O-β-D-glucoside | ChEBI |
| trans-resveratrol 3-β-D-glucoside | ChEBI |
| trans-resveratrol 3-β-glucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10275 | KEGG COMPOUND |
| LMPK13090012 | LIPID MAPS |
| C00002896 | KNApSAcK |
| 4613 | DrugCentral |
| LSM-43202 | LINCS |
| HMDB0030564 | HMDB |
| DB11263 | DrugBank |
| Piceid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:54837 | Reaxys |
| CAS:27208-80-6 | ChemIDplus |
| Citations |
|---|